CymitQuimica logo

CAS 276890-24-5

:

1H-Benz[f]indene,5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-

Description:
1H-Benz[f]indene,5,6,7,8-tetrahydro-5,5,8,8-tetramethyl- is an organic compound characterized by its complex polycyclic structure, which includes a benzene ring fused to an indene framework. This compound features multiple methyl groups, specifically at the 5 and 8 positions, contributing to its steric bulk and potentially influencing its reactivity and physical properties. The presence of the tetrahydro moiety indicates that the compound has undergone partial hydrogenation, resulting in a saturated structure that may exhibit different chemical behavior compared to its unsaturated counterparts. Typically, such compounds may possess interesting optical and electronic properties, making them of interest in materials science and organic synthesis. Additionally, the presence of multiple methyl groups can enhance solubility in organic solvents and affect the compound's boiling and melting points. As with many polycyclic compounds, it may also exhibit unique interactions with biological systems, warranting further investigation into its potential applications in pharmaceuticals or as a chemical intermediate.
Formula:C17H22
InChI:InChI=1S/C17H22/c1-16(2)8-9-17(3,4)15-11-13-7-5-6-12(13)10-14(15)16/h5-6,10-11H,7-9H2,1-4H3
InChI key:HNLISUVQOFXERR-UHFFFAOYSA-N
SMILES:CC1(CCC(C2=C1C=C3CC=CC3=C2)(C)C)C
Synonyms:
  • 5,6,7,8-Tetrahydro-5,5,8,8-tetramethylbenz[f]indene
Found 3 products.