CAS 2769-71-3
:2,6-Dimethylphenyl isocyanide
Description:
2,6-Dimethylphenyl isocyanide, with the CAS number 2769-71-3, is an organic compound characterized by the presence of an isocyanide functional group attached to a 2,6-dimethylphenyl ring. This compound features a distinctive structure that includes a phenyl ring substituted with two methyl groups at the 2 and 6 positions, contributing to its unique chemical properties. Isocyanides are known for their strong and often unpleasant odors, and they exhibit reactivity due to the presence of the isocyanide functional group (-N≡C). This compound is typically used in organic synthesis, particularly in the formation of various nitrogen-containing compounds and in the development of pharmaceuticals. Its reactivity allows it to participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, 2,6-dimethylphenyl isocyanide may exhibit specific physical properties such as solubility in organic solvents and a relatively low boiling point, which are common characteristics of isocyanides. Safety precautions should be taken when handling this compound due to its potential toxicity and reactivity.
Formula:C9H9N
InChI:InChI=1/C9H10N/c1-7-5-4-6-8(2)9(7)10-3/h3-6H,1-2H3/q+1
InChI key:InChIKey=DNJLFZHMJDSJFN-UHFFFAOYSA-N
SMILES:[N+](#[C-])C1=C(C)C=CC=C1C
Synonyms:- 1-Isocyano-2,6-dimethylbenzene
- 2,6-Dimethylisocyanobenzene
- 2,6-Dimethylphenylisonitrile
- 2,6-Xylene isonitrile
- 2,6-Xyleneisonitrile
- 2,6-Xylyl isocyanide
- 2,6-Xylyl isonitrile
- 2,6-dimethyl-N-methylidyneanilinium
- 2-Isocyanato-1,3-Dimethylbenzene
- 2-Isocyano-1,3-dimethylbenzene
- 2-m-Xylyl isocyanide
- Benzene, 2-isocyano-1,3-dimethyl-
- Benzene, 2-isocyano-1,3-dimethyl- (9CI)
- Nsc 141690
- 2,6-Dimethylphenyl isocyanide
- 2,6-Dimethylphenyl isocyanide
- VIC-M-XYLYL ISOCYANIDE
- HANSA ISN-0083
- RARECHEM AQ BD 0027
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,6-Dimethylphenyl isocyanide
CAS:<p>2,6-Dimethylphenyl isocyanate is used in the preparation of homoleptic metallaamidine complex, derivatized bets-cyclodextrins. It is used as chiral stationary phase in normal-phase liquid chromatography. It is also involved in the preparation of tris( 2,6-dimethylphenylimido)methylrhenium (VII) and </p>Formula:C9H9NMolecular weight:131.18Benzene, 2-isocyano-1,3-dimethyl-
CAS:Formula:C9H9NPurity:97%Color and Shape:SolidMolecular weight:131.17452,6-Dimethylphenyl isocyanide
CAS:2,6-Dimethylphenyl isocyanideFormula:C9H9NPurity:97%Color and Shape: yellow solidMolecular weight:131.17g/mol2-Isocyano-1,3-dimethyl-benzene
CAS:<p>2-Isocyano-1,3-dimethyl-benzene is an organic compound that is used to synthesize other compounds. It has a redox potential of -0.6 volts and a crystallography of orthorhombic with a space group of Pbca. It reacts with nitrogen atoms in the reaction solution to form stable complexes and can react with copper ions to form a copper complex. 2-Isocyano-1,3-dimethyl-benzene has been shown to undergo transfer reactions with molybdenum in the presence of xylene as solvent and ammonia gas as a catalyst. This chemical reaction mechanism leads to the formation of an isocyanide intermediate, which then reacts with water molecules to create an aminium ion and hydrogen cyanide. Titration calorimetry experiments have shown that 2-isocyano-1,3-dimethylbenzene has an enthalpy change of -2</p>Formula:C9H9NPurity:Min. 95%Molecular weight:131.17 g/mol




