CAS 2769-72-4
:tert-butyl isocyanoacetate
Description:
Tert-butyl isocyanoacetate is an organic compound characterized by its isocyano functional group and an ester moiety. It is typically a colorless to pale yellow liquid with a distinctive odor. The compound features a tert-butyl group, which contributes to its steric bulk and influences its reactivity. Tert-butyl isocyanoacetate is known for its utility in organic synthesis, particularly in the formation of isocyanides and as a building block in various chemical reactions, including the synthesis of heterocycles. It is generally soluble in organic solvents such as ether and dichloromethane but has limited solubility in water due to its hydrophobic tert-butyl group. The compound should be handled with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use in laboratory settings. Overall, tert-butyl isocyanoacetate is a valuable reagent in synthetic organic chemistry, contributing to the development of complex molecular architectures.
Formula:C7H11NO2
InChI:InChI=1/C7H11NO2/c1-7(2,3)10-6(9)5-8-4/h5H2,1-3H3
SMILES:CC(C)(C)OC(=O)C[N+]#[C-]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetic acid, 2-isocyano-, 1,1-dimethylethyl ester
CAS:Formula:C7H11NO2Purity:97%Color and Shape:LiquidMolecular weight:141.1677Ref: IN-DA002UGQ
1g68.00€5g154.00€10g318.00€1kgTo inquire25gTo inquire100gTo inquire250gTo inquire500gTo inquire100mg26.00€250mg39.00€tert-Butyl 2-Isocyanoacetate
CAS:Formula:C7H11NO2Purity:>98.0%(GC)Color and Shape:Colorless to Brown clear liquidMolecular weight:141.17tert-Butyl isocyanoacetate
CAS:tert-Butyl isocyanoacetatePurity:97%Color and Shape:LiquidMolecular weight:141.16773g/moltert-Butyl isocyanoacetate
CAS:tert-Butyl isocyanoacetate is an organic compound that belongs to the diacid class of organic compounds. It reacts with water to produce the amide and squaramide. Tert-butyl isocyanoacetate has a high affinity for nitrogen atoms, and can be used in uv absorption spectroscopy. It also has a stepwise mechanism and can react with other chemicals to produce new substances. The compound has fluorescence properties and is used in optical devices such as lasers. Tert-butyl isocyanoacetate also has an ester hydrochloride form which is low potency but active methylene catalysed.Formula:C7H11NO2Purity:Min. 95%Color and Shape:Brown Clear LiquidMolecular weight:141.17 g/mol



