CAS 27696-41-9
:Hypolaetin
Description:
Hypolaetin, with the CAS number 27696-41-9, is a naturally occurring flavonoid belonging to the class of compounds known as flavonols. It is primarily found in various plants, particularly in the leaves and fruits of certain species. Hypolaetin is characterized by its polyphenolic structure, which contributes to its antioxidant properties, allowing it to scavenge free radicals and potentially mitigate oxidative stress in biological systems. This compound exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and anticancer effects, making it of interest in pharmacological research. Additionally, hypolaetin may influence various metabolic pathways and has been studied for its potential health benefits. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in both research and potential therapeutic contexts. Overall, hypolaetin represents a significant area of study within natural product chemistry and its implications for health and disease.
Formula:C15H10O7
InChI:InChI=1S/C15H10O7/c16-7-2-1-6(3-8(7)17)12-5-10(19)13-9(18)4-11(20)14(21)15(13)22-12/h1-5,16-18,20-21H
InChI key:InChIKey=ASOIXDIITRKTOX-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC(O)=C(O)C=C3)=C(O)C(O)=CC2O
Synonyms:- Hypoletin
- Hypolaetin
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5,7,8-trihydroxy-
- 2-(3,4-Dihydroxyphenyl)-5,7,8-trihydroxy-4H-1-benzopyran-4-one
- Flavone, 3′,4′,5,7,8-pentahydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
