CAS 2770-01-6
:4-Chloro-1H-imidazo[4,5-c]pyridine
Description:
4-Chloro-1H-imidazo[4,5-c]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a chlorine substituent at the 4-position of the imidazole ring, influencing its reactivity and potential applications. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents, while being less soluble in water due to its aromatic structure. The presence of both nitrogen atoms in the rings enhances its basicity and potential for coordination with metal ions. 4-Chloro-1H-imidazo[4,5-c]pyridine is of interest in medicinal chemistry, particularly for its potential biological activities, including antimicrobial and anticancer properties. Its structural characteristics allow for various synthetic modifications, making it a valuable intermediate in the development of pharmaceuticals and agrochemicals. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C6H4ClN3
InChI:InChI=1/C6H4ClN3/c7-6-5-4(1-2-8-6)9-3-10-5/h1-3H,(H,9,10)
SMILES:c1cnc(c2c1nc[nH]2)Cl
Synonyms:- 1H-Imidazo[4,5-c]pyridine, 4-chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3H-Imidazo[4,5-c]pyridine, 4-chloro-
CAS:Formula:C6H4ClN3Purity:97%Color and Shape:SolidMolecular weight:153.56914-Chloro-1H-imidazo[4,5-c]pyridine
CAS:4-Chloro-1H-imidazo[4,5-c]pyridineFormula:C6H4ClN3Purity:98%Color and Shape: white solidMolecular weight:153.57g/mol4-Chloro-1H-imidazo[4,5-c]pyridine
CAS:Formula:C6H4ClN3Purity:95%Color and Shape:SolidMolecular weight:153.574-Chloro-1H-imidazo[4,5-c]pyridine
CAS:Controlled ProductApplications 4-Chloro-1H-imidazo[4,5-c]pyridine is used as a reagent in the synthesis of 3-bromo-3-deazaneplanocin and 3-bromo-3-deazaaristeromycin, compounds which exhibit antiviral activity.
References Liu, Ch., et al.: Bioorg. Med. Chem. Lett., 22, 5182 (2012)Formula:C11H16N5O·F6PColor and Shape:NeatMolecular weight:379.2424-Chloro-1H-imidazo[4,5-c]pyridine
CAS:4-Chloro-1H-imidazo[4,5-c]pyridine (4CI) is a nucleoside analog that inhibits the replication of RNA and DNA. It has significant inhibitory activity against herpes simplex virus type 1 and human immunodeficiency virus type 1 (HIV-1). 4CI inhibits the synthesis of adenosine, an important component in the synthesis of RNA and DNA. This drug also has antiviral properties against influenza A and B viruses. 4CI's effect on plasma cholesterol levels is thought to be due to inhibition of 3-hydroxy-3-methylglutaryl coenzyme A reductase.Formula:C6H4ClN3Purity:Min. 95%Color and Shape:Off-White SolidMolecular weight:153.57 g/mol





