CAS 2770-75-4
:2-Amino-1,3,5-triazine-4,6-dithiol
Description:
2-Amino-1,3,5-triazine-4,6-dithiol, with the CAS number 2770-75-4, is a heterocyclic compound featuring a triazine ring, which is a six-membered aromatic ring containing three nitrogen atoms and three carbon atoms. This compound is characterized by the presence of amino and dithiol functional groups, which contribute to its reactivity and potential applications in various fields, including agriculture and materials science. The amino group can participate in hydrogen bonding and nucleophilic reactions, while the dithiol moiety can act as a reducing agent or chelating agent for metal ions. The compound is typically soluble in polar solvents, and its stability can be influenced by environmental factors such as pH and temperature. Due to its unique structure, 2-Amino-1,3,5-triazine-4,6-dithiol may exhibit biological activity, making it of interest for research in medicinal chemistry and agrochemicals. However, handling precautions should be observed, as with many chemical substances, to ensure safety in laboratory settings.
Formula:C3H4N4S2
InChI:InChI=1S/C3H4N4S2/c4-1-5-2(8)7-3(9)6-1/h(H4,4,5,6,7,8,9)
InChI key:InChIKey=QQLZTRHXUSFZOM-UHFFFAOYSA-N
SMILES:NC=1NC(=S)NC(=S)N1
Synonyms:- 1,3,5-Triazine-2,4(1H,3H)-dithione, 6-amino-
- 2-Amino-4,6-dimercapto-1,3,5-triazine
- 2-Amino-4,6-dimercapto-s-triazine
- 6-Amino-1,3,5-triazine-2,4(1H,3H)-dithione
- 6-Amino-1,3,5-triazine-2,4-dithiol
- Ammelide, dithio-
- Dithioammelide
- NSC 8147
- s-Triazine-2,4-dithiol, 6-amino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
6-amino-1,3,5-triazine-2,4-dithiol
CAS:6-amino-1,3,5-triazine-2,4-dithiolFormula:C3H4N4S2Purity:90%Color and Shape: cream powderMolecular weight:160.22g/mol2-Amino-1,3,5-triazine-4,6-dithiol - Tech
CAS:2-Amino-1,3,5-triazine-4,6-dithiol (Tech) is a photoinitiator that can be used to initiate polymerization reactions. It is a colorless solid with a melting point of 210°C. This initiator has been shown to be stable in the presence of ethylene and water vapor and can provide high molecular weight polymers when used in combination with other monomers. Tech has been shown to bind well with binder molecules and coatings are formed when it is mixed with deionized water. 2-Amino-1,3,5-triazine-4,6-dithiol initiates polymerization by absorbing light energy and converting it into heat energy, which causes the release of free radicals from its mercapto group. These free radicals then abstract hydrogen atoms from ethylene or water molecules to form acetyl or hydroxyl radicals respectively. The acetyl radical reacts with an ethFormula:C3H4N4S2Purity:90%NmrColor and Shape:SolidMolecular weight:160.22 g/mol


