CAS 277319-62-7: 4-Aminobenzamidoxime
Description:4-Aminobenzamidoxime is an organic compound characterized by the presence of an amino group and an amidoxime functional group attached to a benzene ring. Its molecular structure features a benzene ring substituted with an amino group (-NH2) and an amidoxime group (-C(=NOH)NH2), which contributes to its reactivity and potential applications in various chemical processes. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, which is common for compounds containing amino and hydroxyl functionalities. 4-Aminobenzamidoxime may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C7H9N3O
InChI:InChI=1S/C7H9N3O/c8-6-3-1-5(2-4-6)7(9)10-11/h1-4,11H,8H2,(H2,9,10)
InChI key:InChIKey=CNFNMMJKXWOLPY-UHFFFAOYSA-N
SMILES:N=C(NO)C1=CC=C(N)C=C1
- Synonyms:
- 4-Amino-N'-hydroxybenzenecarboximidamide
- 4-Aminobenzamide oxime
- Benzenecarboximidamide, 4-amino-N'-hydroxy-
- 4-Aminobenzamidoxime
- 4-Amino-N-hydroxybenzimidamide
4-Aminobenzamidoxime, 97%
Ref: 02-H51788
| 1g | To inquire | ||
| 5g | 269.00 € |
Benzenecarboximidamide, 4-amino-N-hydroxy-
Ref: IN-DA002UL3
| 1g | 60.00 € | ||
| 5g | 184.00 € | ||
| 25g | 604.00 € | ||
| 250mg | 25.00 € |
Ref: 54-OR1011430
| 1g | 44.00 € | ||
| 5g | 165.00 € | ||
| 25g | 488.00 € | ||
| 100g | 1,684.00 € | ||
| 250mg | 32.00 € |
Ref: 10-F869711
| 5g | 131.00 € | ||
| 10g | 211.00 € | ||
| 25g | 481.00 € |
4-Aminobenzamide oxime
Ref: 3D-CLA31962
| 5g | 448.00 € |
