CymitQuimica logo

CAS 27740-15-4

:

(3aS,5aR,6S,9bS)-6-hydroxy-5a,9-dimethyl-3-methylidene-3a,5,5a,6,7,9b-hexahydronaphtho[1,2-b]furan-2,8(3H,4H)-dione

Description:
The chemical substance with the name "(3aS,5aR,6S,9bS)-6-hydroxy-5a,9-dimethyl-3-methylidene-3a,5,5a,6,7,9b-hexahydronaphtho[1,2-b]furan-2,8(3H,4H)-dione" and CAS number "27740-15-4" is a complex organic compound characterized by its unique stereochemistry and functional groups. It features a hexahydronaphtho-furan structure, which is indicative of its polycyclic nature. The presence of hydroxyl (-OH) and carbonyl (C=O) groups suggests potential reactivity and solubility in polar solvents. The compound's stereocenters contribute to its three-dimensional shape, influencing its biological activity and interactions with other molecules. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the presence of multiple methyl groups can affect the compound's lipophilicity and overall stability. Understanding its characteristics requires knowledge of its molecular interactions, potential applications, and behavior in various chemical environments.
Formula:C15H18O4
InChI:InChI=1/C15H18O4/c1-7-9-4-5-15(3)11(17)6-10(16)8(2)12(15)13(9)19-14(7)18/h9,11,13,17H,1,4-6H2,2-3H3/t9-,11-,13-,15-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.