CAS 27740-65-4

8-Hydroxytetradecanoic acid

Description:

8-Hydroxytetradecanoic acid, also known as 8-hydroxymyristic acid, is a fatty acid characterized by the presence of a hydroxyl group (-OH) at the eighth carbon of the tetradecanoic acid chain, which consists of 14 carbon atoms. This compound is a white to off-white solid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic carbon chain. The hydroxyl group imparts unique properties, such as increased reactivity and the potential for hydrogen bonding, which can influence its behavior in various chemical reactions and applications. 8-Hydroxytetradecanoic acid is often studied for its potential uses in surfactants, emulsifiers, and as a building block in the synthesis of more complex molecules. Its structural characteristics allow it to participate in various biochemical processes, making it of interest in both industrial and research settings. Additionally, its derivatives may exhibit antimicrobial or antioxidant properties, further expanding its potential applications in pharmaceuticals and cosmetics.

Formula: C₁₄H₂₈O₃

InChI: InChI=1S/C14H28O3/c1-2-3-4-7-10-13(15)11-8-5-6-9-12-14(16)17/h13,15H,2-12H2,1H3,(H,16,17)

InChI key: InChIKey=OVASNIDFAGGBHJ-UHFFFAOYSA-N

SMILES: C(C(CCCCCC)O)CCCCCC(O)=O

Synonyms:

• 8-Hydroxymyristic acid
• Tetradecanoic acid, 8-hydroxy-
• 8-Hydroxytetradecanoic acid

8-HydroxytetradecanoicAcid

CAS: 27740-65-4

Formula: C₁₄H₂₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 244.3703

Ref: IN-DA01E407

8-Hydroxytetradecanoic acid

CAS: 27740-65-4

8-Hydroxytetradecanoic acid

Purity: 98%

Molecular weight: 244.37g/mol

Ref: 54-OR1063374

8-Hydroxytetradecanoic Acid-d11

Controlled Product

CAS: 27740-65-4

Formula: C₁₄H₁₇D₁₁O₃

Color and Shape: Neat

Molecular weight: 450.604

Ref: TR-H954202

8-Hydroxytetradecanoic Acid

Controlled Product

CAS: 27740-65-4

Formula: C₁₄H₂₈O₃

Color and Shape: Neat

Molecular weight: 244.37

Ref: TR-H954200