CAS 27741-65-7
:Ethyl cyclobutylideneacetate
Description:
Ethyl cyclobutylideneacetate, with the CAS number 27741-65-7, is an organic compound characterized by its unique structure, which includes a cyclobutylidene group attached to an acetate moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its pleasant, fruity odor, making it of interest in flavor and fragrance applications. Ethyl cyclobutylideneacetate is relatively stable under standard conditions but may undergo reactions typical of esters, such as hydrolysis in the presence of water and acids or bases. Its molecular structure contributes to its reactivity, particularly in nucleophilic substitution and addition reactions. The compound's solubility in organic solvents, such as ethanol and ether, allows for its use in various chemical syntheses and formulations. Additionally, it may exhibit specific biological activities, although detailed studies on its toxicity and environmental impact are limited. As with all chemical substances, proper handling and safety precautions are essential when working with ethyl cyclobutylideneacetate.
Formula:C8H12O2
InChI:InChI=1/C8H12O2/c1-2-10-8(9)6-7-4-3-5-7/h6H,2-5H2,1H3
SMILES:CCOC(=O)C=C1CCC1
Synonyms:- Acetic Acid, 2-Cyclobutylidene-, Ethyl Ester
- Cyclobutylidene-acetic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetic acid, 2-cyclobutylidene-, ethyl ester
CAS:Formula:C8H12O2Purity:95%Color and Shape:LiquidMolecular weight:140.1797Ethyl cyclobutylideneacetate
CAS:Ethyl cyclobutylideneacetatePurity:97%Color and Shape:LiquidMolecular weight:140.17967g/molEthyl Cyclobutylideneacetate
CAS:Formula:C8H12O2Purity:95%Color and Shape:LiquidMolecular weight:140.182Ethyl cyclobutylideneacetate
CAS:Ethyl cyclobutylideneacetate is a compound that is used as an intermediate in the synthesis of pyrimidine compounds. It has autophagy-inducing activity and can stimulate the growth of epidermal cells. This compound has not been shown to have any direct effects on kinases, but it is known to act as a modulator for factors such as epidermal growth factor, which can regulate cell proliferation. Ethyl cyclobutylideneacetate is active in the presence of solvates and regulators. The tautomers of this compound are stereoisomers that are also homologues, with some polymorphs possible depending on the solvent conditions.
Formula:C8H12O2Purity:Min. 95%Molecular weight:140.18 g/mol



