CAS 27746-03-8

4-Chloro-1H-pyrrole-2-carboxylic acid

Description:

4-Chloro-1H-pyrrole-2-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a carboxylic acid group (-COOH) at the 2-position and a chlorine atom at the 4-position contributes to its chemical reactivity and potential applications. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. Its molecular structure allows for various functional group interactions, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The chlorine substituent can influence the compound's biological activity and reactivity, while the carboxylic acid group can participate in acid-base reactions and form esters or amides. Safety data should be consulted for handling, as with many chemical substances, due to potential toxicity or environmental impact. Overall, 4-Chloro-1H-pyrrole-2-carboxylic acid is a versatile compound with significant implications in chemical research and industry.

Formula: C₅H₄ClNO₂

InChI: InChI=1S/C5H4ClNO2/c6-3-1-4(5(8)9)7-2-3/h1-2,7H,(H,8,9)

InChI key: InChIKey=YOTWVAYGATYZPA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(Cl)=CN1

Synonyms:

• Pyrrole-2-carboxylic acid, 4-chloro-
• 1H-Pyrrole-2-carboxylic acid, 4-chloro-
• 4-Chloro-1H-pyrrole-2-carboxylic acid

1H-Pyrrole-2-carboxylic acid, 4-chloro-

CAS: 27746-03-8

Formula: C₅H₄ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 145.5438

Ref: IN-DA002UNB

4-Chloro-1H-pyrrole-2-carboxylic acid

CAS: 27746-03-8

4-Chloro-1H-pyrrole-2-carboxylic acid

Purity: 96%

Molecular weight: 145.54g/mol

Ref: 54-OR951172

4-Chloro-1H-pyrrole-2-carboxylic acid

CAS: 27746-03-8

Formula: C₅H₄ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 145.54

Ref: 10-F237313

4-Chloro-1H-pyrrole-2-carboxylic acid

CAS: 27746-03-8

4-Chloro-1H-pyrrole-2-carboxylic acid is an intermediate in the synthesis of pyrroles. It can be demethylated with formaldehyde and hydrochloric acid to 4-chloropyridine, or chlorinated with phosphorus pentachloride to 4-chloroquinoline.

Formula: C₅H₄ClNO₂

Purity: Min. 95%

Molecular weight: 145.54 g/mol

Ref: 3D-CBA74603