CAS 27762-87-4

4′-O-Methylalpinumisoflavone

Description:

4′-O-Methylalpinumisoflavone, with the CAS number 27762-87-4, is a naturally occurring flavonoid compound belonging to the isoflavone class. It is primarily derived from various plant sources, particularly those in the legume family. This compound is characterized by its methoxy group at the 4′ position of the isoflavone structure, which contributes to its unique chemical properties and biological activities. 4′-O-Methylalpinumisoflavone exhibits antioxidant properties, which may help in neutralizing free radicals and reducing oxidative stress in biological systems. Additionally, it has been studied for its potential health benefits, including anti-inflammatory and anticancer effects, although further research is necessary to fully understand its mechanisms of action and therapeutic applications. The compound is typically analyzed using techniques such as high-performance liquid chromatography (HPLC) and mass spectrometry to determine its purity and concentration in various extracts. Overall, 4′-O-Methylalpinumisoflavone represents a significant area of interest in phytochemistry and pharmacology due to its potential health-promoting properties.

Formula: C₂₁H₁₈O₅

InChI: InChI=1S/C21H18O5/c1-21(2)9-8-14-16(26-21)10-17-18(19(14)22)20(23)15(11-25-17)12-4-6-13(24-3)7-5-12/h4-11,22H,1-3H3

InChI key: InChIKey=QJSPPBAASCPSJB-UHFFFAOYSA-N

SMILES: OC1=C2C(=CC3=C1C=CC(C)(C)O3)OC=C(C2=O)C4=CC=C(OC)C=C4

Synonyms:

• 2H,6H-Benzo[1,2-b:5,4-b′]dipyran-6-one, 5-hydroxy-7-(p-methoxyphenyl)-2,2-dimethyl-
• 2H,6H-Benzo[1,2-b:5,4-b′]dipyran-6-one, 5-hydroxy-7-(4-methoxyphenyl)-2,2-dimethyl-
• 5-Hydroxy-7-(4-methoxyphenyl)-2,2-dimethyl-2H,6H-benzo[1,2-b:5,4-b′]dipyran-6-one
• 4′-O-Methylalpinumisoflavone
• 4′-Methylalpinumisoflavone

Alpinumisoflavone-4'-methyl ether

CAS: 27762-87-4

Alpinumisoflavone-4'-methyl ether is a methoxyisoflavone, which is a type of naturally occurring phenolic compound. It is derived from specific plant sources, including certain species within the Fabaceae family, known for their rich isoflavonoid content. These compounds are synthesized in plants as part of their defense mechanisms against environmental stresses and pathogens.

Formula: C₂₁H₁₈O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 350.36 g/mol

Ref: 3D-XA161647