CAS 27766-71-8
:(2S,4aS,5R,8aR)-5-methyl-2-propyldecahydroquinoline
Description:
The chemical substance known as (2S,4aS,5R,8aR)-5-methyl-2-propyldecahydroquinoline, with the CAS number 27766-71-8, is a bicyclic organic compound characterized by its complex stereochemistry and saturated ring structure. It belongs to the class of quinolines, which are nitrogen-containing heterocycles. This compound features a decahydroquinoline framework, indicating that it has multiple saturated carbon atoms, contributing to its stability and potential hydrophobic properties. The presence of a methyl group and a propyl group on the nitrogen-containing ring suggests that it may exhibit unique physical and chemical properties, such as varying solubility in organic solvents and potential biological activity. The specific stereochemistry, denoted by the (2S,4aS,5R,8aR) configuration, implies that the compound has multiple chiral centers, which can influence its reactivity and interactions with biological systems. Overall, this compound may have applications in pharmaceuticals or materials science, although specific uses would depend on further research into its properties and behavior.
Formula:C13H25N
InChI:InChI=1/C13H25N/c1-3-5-11-8-9-12-10(2)6-4-7-13(12)14-11/h10-14H,3-9H2,1-2H3/t10-,11+,12+,13-/m1/s1
Synonyms:- quinoline, decahydro-5-methyl-2-propyl-, (2S,4aS,5R,8aR)-
- (2S,4aS,5R,8aR)-5-Methyl-2-propyldecahydroquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pumiliotoxin C
CAS:Pumiliotoxins (PTXs) in dart frog skin have 3 types—A, B (more toxic), C—affect calcium channels, causing paralysis, hyperactivity, or death.Formula:C13H25NColor and Shape:SolidMolecular weight:195.35
