CAS 27773-39-3
:Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-16-methoxy-, methyl ester, (5α,12R,19α)-
Description:
Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-16-methoxy-, methyl ester, with the CAS number 27773-39-3, is a chemical compound that belongs to the class of alkaloids, specifically derived from the Aspidosperma genus of plants. This compound features a complex structure characterized by a tetradehydro configuration, which indicates the presence of multiple double bonds within its carbon skeleton. The methoxy group and the carboxylic acid moiety contribute to its reactivity and potential biological activity. Alkaloids like this one are often studied for their pharmacological properties, including potential effects on the central nervous system and other therapeutic applications. The stereochemistry, indicated by the specific configuration at various chiral centers, plays a crucial role in determining the compound's biological activity and interaction with biological targets. Overall, Aspidospermidine-3-carboxylic acid methyl ester represents a fascinating subject for research in medicinal chemistry and natural product synthesis.
Formula:C22H26N2O3
InChI:InChI=1S/C22H26N2O3/c1-4-21-8-5-10-24-11-9-22(20(21)24)16-7-6-14(26-2)12-17(16)23-18(22)15(13-21)19(25)27-3/h5-8,12,20,23H,4,9-11,13H2,1-3H3/t20-,21-,22-/m0/s1
InChI key:InChIKey=AEXBRBWRPNGGEZ-FKBYEOEOSA-N
SMILES:C(C)[C@@]12[C@]3([C@@]4(C(=C(C(OC)=O)C1)NC=5C4=CC=C(OC)C5)CCN3CC=C2)[H]
Synonyms:- (-)-11-Methoxytabersonine
- 16-Methoxytabersonine
- Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-16-methoxy-, methyl ester, (5α,12R,19α)-
- Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-16-methoxy-, methyl ester, (5α,12β,19α)-
- Aspidospermidine-3-carboxylicacid, 2,3,6,7-tetradehydro-16-methoxy-, methyl ester, (5a,12b,19a)-
- Ervamycine
- Ervamycine (8CI)
- Tabersonine Impurity 3
- VincamineImpurity20
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-16-methoxy-, methyl ester, (5α,12R,19α)-
CAS:Formula:C22H26N2O3Molecular weight:366.4534Ervamycine
CAS:11-Methoxytabersonine (Ervamycine) inhibits five cancer cell lines; IC50 similar to cisplatin, vinorelbine.Formula:C22H26N2O3Purity:98%Color and Shape:SolidMolecular weight:366.45Ervamycine
CAS:Ervamycine is an antibiotic, which is derived from the Actinobacteria genus. Its mode of action involves inhibiting bacterial protein synthesis by binding to the 50S subunit of the ribosome, thereby preventing the translocation of the peptidyl tRNA. This disruption in the translation process effectively halts bacterial growth and proliferation, rendering it a bacteriostatic agent under most conditions.Formula:C22H26N2O3Purity:Min. 95%Molecular weight:366.45 g/mol




