CAS 277756-44-2
:1-(Trifluoromethyl)cyclopentanecarboxylic acid
Description:
1-(Trifluoromethyl)cyclopentanecarboxylic acid is an organic compound characterized by the presence of a cyclopentane ring substituted with a trifluoromethyl group and a carboxylic acid functional group. The trifluoromethyl group (-CF3) is known for its strong electron-withdrawing properties, which can significantly influence the compound's reactivity and acidity. The carboxylic acid group (-COOH) contributes to the compound's acidic nature, making it capable of donating protons in solution. This compound is typically a colorless liquid or solid, depending on the temperature and purity, and is soluble in polar solvents due to the presence of the carboxylic acid. Its unique structure may impart specific properties such as increased lipophilicity and potential applications in pharmaceuticals or agrochemicals. Additionally, the trifluoromethyl group can enhance metabolic stability and bioactivity, making it a valuable moiety in drug design. Overall, 1-(Trifluoromethyl)cyclopentanecarboxylic acid is a compound of interest in various fields of chemistry, particularly in medicinal chemistry and materials science.
Formula:C7H9F3O2
InChI:InChI=1/C7H9F3O2/c8-7(9,10)6(5(11)12)3-1-2-4-6/h1-4H2,(H,11,12)
SMILES:C1CCC(C1)(C(=O)O)C(F)(F)F
Synonyms:- 1-(Trifluoromethyl)Cyclopentane-1-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(Trifluoromethyl)cyclopentanecarboxylic acid, 97%
CAS:<p>1-(Trifluoromethyl)cyclopentanecarboxylic acid is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / ite</p>Formula:C7H9F3O2Purity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:182.14Cyclopentanecarboxylic acid, 1-(trifluoromethyl)-
CAS:Formula:C7H9F3O2Purity:98%Color and Shape:SolidMolecular weight:182.14041-(Trifluoromethyl)cyclopentane-1-carboxylic acid
CAS:<p>1-(Trifluoromethyl)cyclopentane-1-carboxylic acid</p>Purity:99%Molecular weight:182.14g/mol1-Trifluoromethyl-cyclopentanecarboxylic acid
CAS:Formula:C7H9F3O2Purity:98%Color and Shape:Solid, ClearMolecular weight:182.142



