
CAS 27784-70-9
:1,1-Dimethylethyl 2-cyclobutylideneacetate
Description:
1,1-Dimethylethyl 2-cyclobutylideneacetate, with the CAS number 27784-70-9, is an organic compound characterized by its unique structure that includes a cyclobutylidene group and an acetate functional group. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate volatility. It may possess a distinct odor, which is common among many esters. The presence of the cyclobutylidene moiety can influence its reactivity and stability, potentially making it a candidate for various chemical reactions, including those involving nucleophiles or electrophiles. Additionally, the dimethyl substituents contribute to steric hindrance, which can affect the compound's reactivity and interaction with other molecules. While specific physical properties such as boiling point, melting point, and solubility can vary, they are generally influenced by the compound's molecular structure and functional groups. This compound may find applications in organic synthesis, fragrance formulations, or as an intermediate in the production of other chemical substances.
Formula:C10H16O2
InChI:InChI=1S/C10H16O2/c1-10(2,3)12-9(11)7-8-5-4-6-8/h7H,4-6H2,1-3H3
InChI key:InChIKey=FQGSNXJKBRMVEC-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C(C=C1CCC1)=O
Synonyms:- 1,1-Dimethylethyl 2-cyclobutylideneacetate
- Acetic acid, cyclobutylidene-, 1,1-dimethylethyl ester
- Δ1,α-Cyclobutaneacetic acid, tert-butyl ester
- Acetic acid, 2-cyclobutylidene-, 1,1-dimethylethyl ester
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery