CAS 27792-97-8

9-(1,3-benzodioxol-5-yl)-8,8a-dihydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(3aH)-one

Description:

The chemical substance known as 9-(1,3-benzodioxol-5-yl)-8,8a-dihydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(3aH)-one, with the CAS number 27792-97-8, is a complex organic compound characterized by its unique polycyclic structure. This compound features multiple fused rings, including a naphthalene core and dioxole functionalities, which contribute to its potential biological activity. The presence of the benzodioxole moiety suggests possible interactions with biological systems, making it of interest in medicinal chemistry. Its structure may impart specific properties such as solubility, stability, and reactivity, which are crucial for its applications. The compound's synthesis typically involves multi-step organic reactions, and it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Overall, this compound exemplifies the intricate nature of organic molecules and their potential utility in various fields, including pharmaceuticals and materials science.

Formula: C₂₀H₁₄O₆

InChI: InChI=1/C20H14O6/c21-20-13-3-11-5-17-18(26-9-25-17)6-12(11)19(14(13)7-22-20)10-1-2-15-16(4-10)24-8-23-15/h1-6,14,17H,7-9H2

SMILES: c1cc2c(cc1C1=C3C=C4C(C=C3C=C3C1COC3=O)OCO4)OCO2

Furo[3',4':6,7]naphtho[2,3-d]-1,3-dioxol-6(8H)-one, 9-(1,3-benzodioxol-5-yl)-

CAS: 27792-97-8

Formula: C₂₀H₁₂O₆

Molecular weight: 348.3057

Ref: IN-DA002URJ

Justicidin E

Controlled Product

CAS: 27792-97-8

Formula: C₂₀H₁₂O₆

Color and Shape: Neat

Molecular weight: 348.306

Ref: TR-J100270

Justicidin E

CAS: 27792-97-8

Justicidin E is a potent inhibitor that has been found in the urine of Chinese medicinal plants. It has been shown to have anticancer properties by inhibiting tumor growth and inducing apoptosis in cancer cells. Justicidin E works by inhibiting protein kinases, which are enzymes that play a crucial role in cell division and proliferation. This inhibition leads to the suppression of cancer cell growth and the promotion of apoptosis. Justicidin E is an analog of glycerol, a naturally occurring organic compound found in many foods and beverages. Its unique chemical structure makes it an effective inhibitor of cancer cell growth without causing significant toxicity to healthy human cells. With its promising potential as an anticancer agent, Justicidin E is being studied extensively for its medicinal properties.

Formula: C₂₀H₁₂O₆

Purity: Min. 95%

Molecular weight: 348.3 g/mol

Ref: 3D-CBA79297