CAS 27798-60-3
:Methyl 2-methoxybenzeneacetate
Description:
Methyl 2-methoxybenzeneacetate, also known as methyl o-anisate, is an organic compound characterized by its ester functional group. It is derived from the reaction of 2-methoxybenzoic acid and methanol. This compound typically appears as a colorless to pale yellow liquid with a pleasant, sweet aroma, making it useful in the fragrance and flavoring industries. Its molecular structure features a methoxy group (-OCH3) attached to a benzene ring, which contributes to its aromatic properties. Methyl 2-methoxybenzeneacetate is generally soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. It is often utilized in the synthesis of other chemical compounds and may exhibit low toxicity, although safety precautions should always be observed when handling chemicals. As with many esters, it may undergo hydrolysis in the presence of water, reverting to its acid and alcohol components. Overall, this compound is valued for its aromatic qualities and versatility in various chemical applications.
Formula:C10H12O3
InChI:InChI=1S/C10H12O3/c1-12-9-6-4-3-5-8(9)7-10(11)13-2/h3-6H,7H2,1-2H3
InChI key:InChIKey=BNQRSYFOIRGRKV-UHFFFAOYSA-N
SMILES:C(C(OC)=O)C1=C(OC)C=CC=C1
Synonyms:- 2-Methoxyphenylacetic acid methyl ester
- Acetic acid, (o-methoxyphenyl)-, methyl ester
- Benzeneacetic acid, 2-methoxy-, methyl ester
- Methyl (2-Methoxyphenyl)Acetate
- Methyl 2-methoxybenzeneacetate
- Methyl o-methoxyphenylacetate
- NSC 245109
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2-Methoxyphenylacetate
CAS:Formula:C10H12O3Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:180.20Benzeneacetic acid, 2-methoxy-, methyl ester
CAS:Formula:C10H12O3Purity:96%Color and Shape:LiquidMolecular weight:180.20052-Methoxyphenylacetic acid methyl ester
CAS:2-Methoxyphenylacetic acid methyl esterPurity:98%Color and Shape:LiquidMolecular weight:180.20g/molMethyl 2-methoxyphenylacetate
CAS:Formula:C10H12O3Purity:96%Color and Shape:No data available.Molecular weight:180.2032-Methoxyphenylacetic acid methyl ester
CAS:2-Methoxyphenylacetic acid methyl ester is an enolate that is formed by the demethylation of cinchonidine. The proton of the methyl group can be displaced and 2-methoxyphenylacetic acid methyl ester becomes a nucleophile, attacking the electrophilic carbon atom in malonate to form an intermediate. The molecular modeling and optimized structures have been obtained using quantum mechanics calculations. The chloride ion is used as a counterion to stabilize the negative charge on the phenyl groups, which are substituted with isoflavonoid. Metal ions such as lithium cations are also important for stabilization purposes. Ammonium nitrate is used as an efficient method to produce this compound in high yield.Formula:C10H12O3Purity:Min. 95%Molecular weight:180.2 g/mol




