CAS 278-06-8
:Tetracyclo[3.2.0.02,7.04,6]heptane
Description:
Tetracyclo[3.2.0.02,7.04,6]heptane, with the CAS number 278-06-8, is a polycyclic hydrocarbon characterized by its unique tetracyclic structure, which consists of seven carbon atoms arranged in a complex framework. This compound features a highly strained bicyclic system due to the presence of multiple rings that share common edges. Its molecular formula is C7H10, indicating a relatively low hydrogen count compared to its carbon skeleton, which contributes to its distinctive chemical properties. Tetracycloheptane is typically colorless and exhibits a solid state at room temperature. The strain in its structure can lead to interesting reactivity, making it a subject of study in organic chemistry, particularly in the context of ring strain and stability. Additionally, its unique arrangement can influence its physical properties, such as melting and boiling points, as well as its solubility in various solvents. Overall, tetracycloheptane serves as an intriguing example of complex hydrocarbon structures in organic synthesis and materials science.
Formula:C7H8
InChI:InChI=1S/C7H8/c1-2-4-5(2)7-3(1)6(4)7/h2-7H,1H2
InChI key:InChIKey=DGZUEIPKRRSMGK-UHFFFAOYSA-N
SMILES:C12C3C4C1C2CC34
Synonyms:- Tetracyclo(2.2.1.02,6.03,5)Heptane
- Tetracyclo[2.2.1.0<sup>2,6</sup>.0<sup>3,5</sup>]heptane
- Tetracyclo[3.2.0.0<sup>2,7</sup>.0<sup>4,6</sup>]heptane
- Tetracyclo[3.2.0.0~2,7~.0~4,6~]Heptane
- [2.2.1.0<sup>2,6</sup>.0<sup>3,5</sup>]Quadricycloheptane
- [2.2.1.02,6.03,5]Quadricycloheptane
- Tetracyclo[3.2.0.02,7.04,6]heptane
- Quadricyclane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

