CAS 27814-48-8
:Poly(glycidyl nitrate)
Description:
Poly(glycidyl nitrate) is a polymeric compound characterized by its structure, which consists of repeating units derived from glycidyl nitrate. This substance is known for its energetic properties, making it of interest in the field of explosives and propellants. Poly(glycidyl nitrate) exhibits a high degree of stability under normal conditions, but it can decompose exothermically when subjected to heat or shock, which is a critical consideration for its handling and storage. The polymer is typically soluble in organic solvents, which facilitates its processing and application in various formulations. Additionally, it possesses a relatively low viscosity, allowing for easy manipulation during synthesis and application. Its energetic characteristics are attributed to the nitrate groups present in the polymer backbone, which contribute to its potential as a high-energy material. Safety measures are essential when working with poly(glycidyl nitrate) due to its reactive nature, and it is often studied in the context of developing safer and more efficient energetic materials.
Formula:(C3H5NO4)x
InChI:InChI=1S/C3H5NO4/c5-4(6)8-2-3-1-7-3/h3H,1-2H2
InChI key:InChIKey=ADZAAKGRMMGJKM-UHFFFAOYSA-N
SMILES:C(ON(=O)=O)C1CO1
Synonyms:- Poly(glycidyl nitrate)
- 1-Propanol, 2,3-epoxy-, nitrate, polymers
- Oxiranemethanol, nitrate, homopolymer
- 2-Oxiranemethanol, 2-nitrate, homopolymer
- Glycidyl nitrate homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Peptidoglycan - from Staphylococcus aureus
CAS:The sugar component consists of alternating residues of β-(1,4) linked N-acetylglucosamine and N-acetylmuramic acid. A peptide chain of three to five amino acids is attached to the N-acetylmuramic acid. The peptide chain can be cross-linked to the peptide chain of another strand forming the 3D mesh-like layer.Color and Shape:Powder


