CAS 278183-10-1

methyl 4-amino-1,3-thiazole-5-carboxylate

Description:

Methyl 4-amino-1,3-thiazole-5-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group (-NH2) at the 4-position and a carboxylate group (-COOCH3) at the 5-position, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid, soluble in polar solvents such as water and methanol, which facilitates its use in various chemical reactions and applications. The presence of the thiazole moiety often imparts interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, the methyl ester group enhances its lipophilicity, potentially influencing its absorption and distribution in biological systems. Overall, methyl 4-amino-1,3-thiazole-5-carboxylate is a versatile compound with applications in drug development and synthetic chemistry.

Formula: C₅H₆N₂O₂S

InChI: InChI=1/C5H6N2O2S/c1-9-5(8)3-4(6)7-2-10-3/h2H,6H2,1H3

SMILES: COC(=O)c1c(N)ncs1

Synonyms:

• 5-Thiazolecarboxylic Acid, 4-Amino-, Methyl Ester
• Methyl 4-amino-5-thiazolecarboxylate

5-Thiazolecarboxylic acid, 4-amino-, methyl ester

CAS: 278183-10-1

Formula: C₅H₆N₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 158.1783

Ref: IN-DA002UTR

Methyl 4-amino-1,3-thiazole-5-carboxylate

CAS: 278183-10-1

Methyl 4-amino-1,3-thiazole-5-carboxylate

Formula: C₅H₆N₂O₂S

Purity: ≥95%

Color and Shape: brown powder

Molecular weight: 158.17834g/mol

Ref: 54-OR301121

Methyl 4-amino-5-thiazolecarboxylate

CAS: 278183-10-1

Formula: C₅H₆N₂O₂S

Purity: 95%

Color and Shape: Solid, Powder

Molecular weight: 158.18

Ref: 10-F209233