CAS 27825-74-7
:2,2',2'',2''',2''''-(ethane-1,2-diylnitrilo)pentaacetonitrile
Description:
2,2',2'',2''',2''''-(ethane-1,2-diylnitrilo)pentaacetonitrile, with the CAS number 27825-74-7, is a complex organic compound characterized by its multiple nitrile functional groups. This substance features a central ethane backbone with nitrile groups (-C≡N) attached, which significantly influences its chemical properties, including polarity and reactivity. The presence of multiple acetonitrile units contributes to its potential as a ligand in coordination chemistry, particularly in the formation of metal complexes. The compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents due to its nitrile groups. Its synthesis often involves multi-step organic reactions, and it may be utilized in various applications, including materials science and catalysis. Safety data should be consulted, as compounds with multiple nitrile groups can pose health risks, including toxicity and potential environmental hazards. Proper handling and storage conditions are essential to ensure safety during use.
Formula:C14H18N8
InChI:InChI=1/C14H18N8/c15-1-6-20(7-2-16)11-13-22(10-5-19)14-12-21(8-3-17)9-4-18/h6-14H2
SMILES:C(#N)CN(CC#N)CCN(CC#N)CCN(CC#N)CC#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Acetonitrile, 2,2',2'',2'''-[[(cyanomethyl)imino]bis(2,1-ethanediylnitrilo)]tetrakis-
CAS:Formula:C14H18N8Molecular weight:298.3463

