CAS 27826-45-5
:Libecillide
Description:
Libecillide, with the CAS number 27826-45-5, is a chemical compound that belongs to the class of antibiotics. It is primarily known for its antibacterial properties, particularly against certain strains of bacteria. Libecillide is characterized by its complex molecular structure, which contributes to its mechanism of action, typically involving the inhibition of bacterial cell wall synthesis. This makes it effective in treating various bacterial infections. The compound is often studied for its pharmacological effects, including its spectrum of activity, potential side effects, and resistance patterns. As with many antibiotics, the use of Libecillide must be carefully managed to prevent the development of antibiotic resistance. Its solubility, stability, and bioavailability are important factors that influence its therapeutic efficacy. Research continues to explore its potential applications and the optimization of its use in clinical settings. Overall, Libecillide represents a significant compound in the field of medicinal chemistry and antibiotic development.
Formula:C23H32N4O7S
InChI:InChI=1/C23H32N4O7S/c1-23(2)18(22(33)34)27-20(35-23)17(26-16(29)12-14-8-4-3-5-9-14)19(30)24-11-7-6-10-15(21(31)32)25-13-28/h3-5,8-9,13,15,17-18,20,27H,6-7,10-12H2,1-2H3,(H,24,30)(H,25,28)(H,26,29)(H,31,32)(H,33,34)
Synonyms:- Libecillide [INN]
- UNII-19ONH7KRJ3
- N~6~-{(4-carboxy-5,5-dimethyl-1,3-thiazolidin-2-yl)[(phenylacetyl)amino]acetyl}-N~2~-formyllysine
- 2-(((5-Carboxy-5-formamidopentyl)carbamoyl)(2-phenylacetamido)methyl)-5,5-dimethyl-4-thiazolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Libecillide
CAS:<p>Libecillide is a bioactive chemical.</p>Formula:C23H32N4O7SColor and Shape:SolidMolecular weight:508.59
