CAS 27826-76-2
:4-(methylamino)-1-(beta-D-ribofuranosyl)-1,3,5-triazin-2(1H)-one
Description:
4-(Methylamino)-1-(beta-D-ribofuranosyl)-1,3,5-triazin-2(1H)-one, with the CAS number 27826-76-2, is a chemical compound that belongs to the class of triazine derivatives. This substance features a triazine ring, which is a six-membered heterocyclic structure containing three nitrogen atoms and three carbon atoms. The presence of a methylamino group enhances its solubility and reactivity, while the beta-D-ribofuranosyl moiety indicates that it is a nucleoside analogue, potentially influencing its biological activity. The compound is of interest in medicinal chemistry, particularly for its potential applications in antiviral or anticancer therapies, as it may interfere with nucleic acid synthesis. Its structural characteristics suggest that it could engage in hydrogen bonding and other interactions, which are crucial for its biological function. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of study in various chemical and biological contexts.
Formula:C9H14N4O5
InChI:InChI=1/C9H14N4O5/c1-10-8-11-3-13(9(17)12-8)7-6(16)5(15)4(2-14)18-7/h3-7,14-16H,2H2,1H3,(H,10,12,17)/t4-,5-,6-,7-/m1/s1
SMILES:CN=c1ncn([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)c(n1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N4-Methyl-5-azacytidine
CAS:<p>N4-Methyl-5-azacytidine is a benzoylated and chlorinated derivative of 5-azacytidine. It is an inhibitor of DNA methylation that inhibits the synthesis of DNA and RNA. N4-Methyl-5-azacytidine has been shown to be carcinogenic in humans, but not in other animals. It also has antibacterial activity against Gram-positive bacteria. This compound is stable in water and can be synthesized by ammonolysis of dimethylamine chloride with sodium azide in dimethylformamide at 100 °C for 2 hours. The product precipitates as a white solid when cooled to room temperature.</p>Formula:C9H14N4O5Purity:Min. 95%Molecular weight:258.23 g/mol
