CAS 27829-46-5
:N,N-diethyl-3-phenylprop-2-enamide
Description:
N,N-Diethyl-3-phenylprop-2-enamide, with the CAS number 27829-46-5, is an organic compound characterized by its amide functional group and an alkene structure. This compound features a phenyl group attached to a propene backbone, specifically at the 3-position, while two ethyl groups are bonded to the nitrogen atom of the amide. The presence of the double bond in the propene moiety contributes to its reactivity, making it potentially useful in various chemical reactions, including polymerization and as an intermediate in organic synthesis. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents, such as ethanol and dichloromethane, allows for diverse applications in chemical research and industry. Additionally, the compound's structure suggests potential biological activity, which may warrant further investigation in pharmacological studies. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H17NO
InChI:InChI=1/C13H17NO/c1-3-14(4-2)13(15)11-10-12-8-6-5-7-9-12/h5-11H,3-4H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
