CAS 27830-12-2
:2-(Octyloxy)benzoic acid
Description:
2-(Octyloxy)benzoic acid is an organic compound characterized by its aromatic structure, featuring a benzoic acid moiety substituted with an octyloxy group at the second position. This compound typically exhibits both hydrophobic and hydrophilic properties due to the long hydrocarbon chain of the octyloxy group and the carboxylic acid functional group, respectively. It is likely to be a solid at room temperature, with a relatively high melting point compared to simpler benzoic acids due to the presence of the long alkyl chain, which can enhance its molecular interactions. The octyloxy group contributes to its solubility in organic solvents while limiting its solubility in water. This compound may find applications in various fields, including materials science, as a surfactant, or in the formulation of liquid crystals. Additionally, its unique structure may impart specific properties that could be useful in the development of functional materials or as intermediates in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C15H22O3
InChI:InChI=1S/C15H22O3/c1-2-3-4-5-6-9-12-18-14-11-8-7-10-13(14)15(16)17/h7-8,10-11H,2-6,9,12H2,1H3,(H,16,17)
InChI key:InChIKey=VSDNNWKISVRDNT-UHFFFAOYSA-N
SMILES:O(CCCCCCCC)C1=C(C(O)=O)C=CC=C1
Synonyms:- Benzoic Acid, 2-(Octyloxy)-
- Benzoic acid, o-(octyloxy)-
- 2-(Octyloxy)benzoic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-(Octyloxy)Benzoic Acid
CAS:Formula:C15H22O3Purity:95%Color and Shape:LiquidMolecular weight:250.33342-(Octyloxy)Benzoic Acid
CAS:2-(Octyloxy)Benzoic AcidFormula:C15H22O3Purity:>95%Molecular weight:250.332-(Octyloxy)benzoic acid
CAS:2-(Octyloxy)benzoic acidFormula:C15H22O3Purity:95%Molecular weight:250.33(2-Octyloxy)benzoic Acid
CAS:Controlled ProductFormula:C15H22O3Color and Shape:NeatMolecular weight:250.3332-(Octyloxy)benzoic acid
CAS:2-(Octyloxy)benzoic acid is a molecule that has the chemical formula C8H10O4. It can be found in animals and humans as a metabolite of hydroxybenzoic acid, which is a metabolite of hydrochloric acid. This compound has been used for the synthesis of organic compounds, such as diphenols and hydroxypyridines. The geometric isomers are important for the synthesis of 2-(octyloxy)benzoic acid because they provide different synthetic routes. When synthesized from an animal health perspective, this molecule can be found in bovine milk or eggs, where it may serve as a precursor to cholesterol or testosterone. From an industrial perspective, 2-(octyloxy)benzoic acid can be synthesized by heating sodium octanoate with hydrochloric acid and decomposing water to form hydrogen chloride and octane.Formula:C15H22O3Purity:Min. 95%Molecular weight:250.33 g/mol






