CAS 27831-13-6
:4-ethenyl-1,2-dimethylbenzene
Description:
4-Ethenyl-1,2-dimethylbenzene, also known as p-divinyl toluene, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methyl groups and a vinyl group at the para position. This compound is a colorless to pale yellow liquid with a characteristic aromatic odor. It is known for its reactivity due to the presence of the vinyl group, which can participate in various polymerization reactions, making it useful in the production of polymers and resins. The compound is relatively stable under standard conditions but can undergo polymerization when exposed to heat or light. It is slightly soluble in water but more soluble in organic solvents. Safety considerations include potential skin and eye irritation, and it should be handled with appropriate precautions in a well-ventilated area. Overall, 4-ethenyl-1,2-dimethylbenzene is significant in industrial applications, particularly in the synthesis of cross-linked polymers and as a monomer in various chemical processes.
Formula:C10H12
InChI:InChI=1/C10H12/c1-4-10-6-5-8(2)9(3)7-10/h4-7H,1H2,2-3H3
SMILES:C=Cc1ccc(C)c(C)c1
Synonyms:- 1,2-Dimethyl-4-vinylbenzene
- Benzene, 4-Ethenyl-1,2-Dimethyl-
- Styrene, 3,4-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Ethenyl-1,2-dimethylbenzene
CAS:4-Ethenyl-1,2-dimethylbenzene is a volatile oil that has been found in plants and is a metabolite of styrene. It is classified as a vinyl group, which are compounds with the general formula CH=CH2. 4-Ethenyl-1,2-dimethylbenzene is also a volatile substance, meaning that it evaporates easily from surfaces or materials. This compound may be used as an intermediate for other organic chemicals.
Formula:C10H12Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:132.2 g/molRef: 3D-CBA83113
Discontinued product

