CymitQuimica logo

CAS 27832-58-2

:

Piperidine, 3,3-dimethyl-, hydrochloride (1:1)

Description:
Piperidine, 3,3-dimethyl-, hydrochloride (1:1), with the CAS number 27832-58-2, is a chemical compound that belongs to the class of piperidine derivatives. It is characterized by a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of two methyl groups at the 3-position of the piperidine ring contributes to its unique properties, including its potential as a building block in organic synthesis and medicinal chemistry. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and makes it easier to handle in laboratory settings. The compound may exhibit basic properties due to the nitrogen atom, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Its applications can range from use in pharmaceuticals to serving as an intermediate in the synthesis of other organic compounds. Safety data should be consulted, as with all chemical substances, to ensure proper handling and usage.
Formula:C7H15N·ClH
InChI:InChI=1S/C7H15N.ClH/c1-7(2)4-3-5-8-6-7;/h8H,3-6H2,1-2H3;1H
InChI key:InChIKey=BXFKQBZPFQBCCO-UHFFFAOYSA-N
SMILES:CC1(C)CCCNC1.Cl
Synonyms:
  • 3,3-Dimethylpiperidine hydrochloride
  • Piperidine, 3,3-dimethyl-, hydrochloride
  • Piperidine, 3,3-dimethyl-, hydrochloride (1:1)
Found 4 products.