CAS 2785-06-0
:2,3-dimethyl-1,3-benzothiazol-3-ium
Description:
2,3-Dimethyl-1,3-benzothiazol-3-ium, with the CAS number 2785-06-0, is a heterocyclic organic compound characterized by its benzothiazole structure, which incorporates a sulfur and nitrogen atom within a fused ring system. This compound features two methyl groups at the 2 and 3 positions of the benzothiazole ring, contributing to its unique chemical properties. It typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including organic synthesis and as a dye or pigment due to its chromophoric properties. The presence of the positively charged nitrogen atom in the 3 position enhances its reactivity and solubility in polar solvents. Additionally, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with their use.
Formula:C9H10NS
InChI:InChI=1/C9H10NS/c1-7-10(2)8-5-3-4-6-9(8)11-7/h3-6H,1-2H3/q+1
Synonyms:- benzothiazolium, 2,3-dimethyl-
- 2,3-Dimethyl-benzothiazol-3-ium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzothiazolium, 2,3-dimethyl-, iodide
CAS:Formula:C9H10INSPurity:98%Color and Shape:SolidMolecular weight:291.15192,3-Dimethyl-1,3-benzothiazol-3-ium Iodide
CAS:Formula:C9H10INSPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:291.152,3-Dimethylbenzo[D]thiazol-3-ium iodide
CAS:2,3-Dimethylbenzo[D]thiazol-3-ium iodide is a benzothiazolium salt.Formula:C9H10INSPurity:Min. 95%Molecular weight:291.15 g/mol2,3-Dimethylbenzo[D]thiazol-3-ium iodide
CAS:<p>Please enquire for more information about 2,3-Dimethylbenzo[D]thiazol-3-ium iodide including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C9H10INSMolecular weight:291.15 g/mol




