CAS 278603-08-0
:3-benzyl-1-hexadecyl-2-methyl-1H-imidazol-3-ium iodide
Description:
3-Benzyl-1-hexadecyl-2-methyl-1H-imidazol-3-ium iodide is a quaternary ammonium compound characterized by its imidazolium structure, which features a positively charged nitrogen atom within a five-membered ring. This compound exhibits amphiphilic properties due to the presence of a long hydrophobic hexadecyl chain and a hydrophilic imidazolium head, making it suitable for applications in surfactants and emulsifiers. The benzyl group enhances its solubility in organic solvents and may contribute to its biological activity. As an iodide salt, it is likely to be soluble in polar solvents, while the long alkyl chain provides lipophilicity. The compound may also exhibit antimicrobial properties, making it of interest in pharmaceutical and cosmetic formulations. Its stability and reactivity can be influenced by the presence of the iodide counterion, which can participate in various chemical reactions. Overall, this compound's unique structural features lend it potential utility in various fields, including materials science and biochemistry.
Formula:C27H45IN2
InChI:InChI=1/C27H45N2.HI/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-28-23-24-29(26(28)2)25-27-20-17-16-18-21-27;/h16-18,20-21,23-24H,3-15,19,22,25H2,1-2H3;1H/q+1;/p-1
Synonyms:- 1-Benzyl-3-hexadecyl-2-methyl-1H-imidazol-3-ium iodide
- 1H-Imidazolium, 3-hexadecyl-2-methyl-1-(phenylmethyl)-, iodide (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
eEF-2 Kinase Inhibitor, NH125
CAS:Formula:C27H45IN2Purity:%Color and Shape:SolidMolecular weight:524.56413-Benzyl-1-Hexadecyl-2-Methyl-1H-Imidazol-3-Ium Iodide
CAS:3-Benzyl-1-Hexadecyl-2-Methyl-1H-Imidazol-3-Ium IodidePurity:98%Molecular weight:524.56g/molNH125
CAS:<p>NH125 is a selective eEF-2 kinase inhibitor with IC50 of 60 nM, >125-fold selectivity over PKC, PKA, and CaMKII, and also a potent histidine kinase inhibitor.</p>Formula:C27H45IN2Purity:98.60%Color and Shape:SolidMolecular weight:524.56





