CAS 278610-39-2

N-(2-Chloro-3-pyridyl)maleimide

Description:

N-(2-Chloro-3-pyridyl)maleimide is a chemical compound characterized by its unique structure, which includes a maleimide moiety and a pyridine ring substituted with a chlorine atom. This compound typically appears as a solid and is known for its reactivity, particularly in forming covalent bonds with nucleophiles, making it useful in various chemical synthesis applications. The presence of the maleimide group allows for Michael addition reactions, while the chloropyridine component can participate in further functionalization. It is often utilized in the development of pharmaceuticals and agrochemicals due to its ability to act as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety data sheets should be consulted for handling and storage guidelines, as with many chemical substances, it may pose health risks if not managed properly. Overall, N-(2-Chloro-3-pyridyl)maleimide is a versatile compound with significant potential in various fields of chemistry.

Formula: C₉H₅ClN₂O₂

InChI: InChI=1/C9H5ClN2O2/c10-9-6(2-1-5-11-9)12-7(13)3-4-8(12)14/h1-5H

SMILES: c1cc(c(Cl)nc1)N1C(=O)C=CC1=O

Synonyms:

• 1H-pyrrole-2,5-dione, 1-(2-chloro-3-pyridinyl)-
• 1-(2-chloropyridin-3-yl)-1H-pyrrole-2,5-dione

1-(2-CHLORO-3-PYRIDYL)-2,5-DIHYDRO-1H-PYRROLE-2,5-DIONE

CAS: 278610-39-2

Formula: C₉H₅ClN₂O₂

Purity: 98%

Molecular weight: 208.6012

Ref: IN-DA00BCZ3

1-(2-Chloropyridin-3-yl)-1H-pyrrole-2,5-dione

CAS: 278610-39-2

Purity: 98%

Molecular weight: 208.6000061

Ref: 10-F750123