CAS 278614-92-9

5-Chloro-2-methyl-7H-isoxazolo[2,3-a]pyrimidin-7-one

Description:

5-Chloro-2-methyl-7H-isoxazolo[2,3-a]pyrimidin-7-one is a heterocyclic compound characterized by its unique isoxazole and pyrimidine structures. This compound features a chlorine atom at the 5-position and a methyl group at the 2-position of the isoxazole ring, contributing to its chemical reactivity and potential biological activity. The presence of the isoxazole moiety suggests that it may exhibit properties typical of nitrogen-containing heterocycles, such as antimicrobial or anti-inflammatory activities. The compound is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. Its molecular structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's CAS number, 278614-92-9, provides a unique identifier that facilitates its identification in chemical databases and literature. Overall, 5-Chloro-2-methyl-7H-isoxazolo[2,3-a]pyrimidin-7-one represents a class of compounds that may have significant applications in pharmaceuticals and agrochemicals.

Formula: C₇H₅ClN₂O₂

InChI: InChI=1S/C7H5ClN2O2/c1-4-2-6-9-5(8)3-7(11)10(6)12-4/h2-3H,1H3

InChI key: InChIKey=XNAWHAKTUSSDKH-UHFFFAOYSA-N

SMILES: O=C1N2C(C=C(C)O2)=NC(Cl)=C1

Synonyms:

• 7H-Isoxazolo[2,3-a]pyrimidin-7-one, 5-chloro-2-methyl-
• 5-Chloro-2-methyl-7H-isoxazolo[2,3-a]pyrimidin-7-one

5-Chloro-2-methyl-7h-isoxazolo[2,3-a]pyrimidin-7-one

CAS: 278614-92-9

Versatile small molecule scaffold

Formula: C₇H₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 184.58 g/mol

Ref: 3D-DLA61492