CAS 27866-86-0

(1R,2S)-2-phenacylcyclohexane-1-carboxylic acid

Description:

(1R,2S)-2-phenacylcyclohexane-1-carboxylic acid is a chiral compound characterized by its cyclohexane ring structure, which is substituted at the 1 and 2 positions. The presence of a phenacyl group at the 2-position and a carboxylic acid functional group at the 1-position contributes to its chemical reactivity and potential applications in organic synthesis. This compound exhibits stereochemical specificity due to its chiral centers, which can influence its biological activity and interactions with other molecules. The carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound's structural features may affect its solubility, melting point, and overall stability. As a result, (1R,2S)-2-phenacylcyclohexane-1-carboxylic acid may be of interest in fields such as medicinal chemistry and materials science, where chirality and functional group reactivity are crucial for the development of new compounds and materials.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c16-14(11-6-2-1-3-7-11)10-12-8-4-5-9-13(12)15(17)18/h1-3,6-7,12-13H,4-5,8-10H2,(H,17,18)/t12-,13+/m0/s1

InChI key: RKPPDKWMENPRKR-QWHCGFSZSA-N

SMILES: C1CC[C@H]([C@@H](C1)CC(=O)C2=CC=CC=C2)C(=O)O