CAS 278779-30-9: 3-[2-[2-Chloro-4-[[3-(2,6-dichlorophenyl)-5-(1-methylethyl)-4-isoxazolyl]methoxy]phenyl]ethenyl]benzoic acid
Description:3-[2-[2-Chloro-4-[[3-(2,6-dichlorophenyl)-5-(1-methylethyl)-4-isoxazolyl]methoxy]phenyl]ethenyl]benzoic acid, with CAS number 278779-30-9, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups. This compound features a benzoic acid moiety, indicating it possesses acidic properties, and is likely to exhibit moderate solubility in organic solvents. The presence of chlorine and isoxazole groups suggests potential biological activity, possibly as a pharmaceutical agent or in agrochemical applications. Its intricate structure may contribute to specific interactions with biological targets, making it of interest in medicinal chemistry. The compound's stability, reactivity, and potential applications would depend on its specific functional groups and overall molecular conformation. As with many synthetic compounds, safety and handling precautions are essential, particularly due to the presence of chlorine substituents, which can influence toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C28H22Cl3NO4
InChI:InChI=1S/C28H22Cl3NO4/c1-16(2)27-21(26(32-36-27)25-22(29)7-4-8-23(25)30)15-35-20-12-11-18(24(31)14-20)10-9-17-5-3-6-19(13-17)28(33)34/h3-14,16H,15H2,1-2H3,(H,33,34)
InChI key:InChIKey=BYTNEISLBIENSA-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=CC=C(C=CC2=CC=C(OCC=3C(=NOC3C(C)C)C=4C(Cl)=CC=CC4Cl)C=C2Cl)C1
- Synonyms:
- 3-(2,6-Dichlorophenyl)-4-(3'-carboxy-2-chlorostilben-4-yl)oxymethyl-5-isopropylisoxazole
- 3-[(E)-2-(2-chloro-4-{[3-(2,6-dichlorophenyl)-5-(1-methylethyl)isoxazol-4-yl]methoxy}phenyl)ethenyl]benzoic acid
- 3-[2-[2-Chloro-4-[[3-(2,6-dichlorophenyl)-5-(1-methylethyl)-4-isoxazolyl]methoxy]phenyl]ethenyl]benzoic acid
- Benzoic acid, 3-[2-[2-chloro-4-[[3-(2,6-dichlorophenyl)-5-(1-methylethyl)-4-isoxazolyl]methoxy]phenyl]ethenyl]-
- GW 4064
![3-[2-[2-Chloro-4-[[3-(2,6-dichlorophenyl)-5-(1-methylethyl)-4-isoxazolyl]methoxy]phenyl]ethenyl]be…](https://static.cymitquimica.com/cas-image/340226-3-2-2-chloro-4-3-26-dichlorophenyl-5-1-methylethyl-4-isoxazolyl-methoxy-phenyl-ethenyl-benzoic-acid.png)
![3-[2-[2-Chloro-4-[[3-(2,6-dichlorophenyl)-5-(1-methylethyl)-4-isoxazolyl]methoxy]phenyl]ethenyl]be…](https://static.cymitquimica.com/products/IN/thumb/DA0039P7.jpg)
