CAS 278798-08-6
:4-(1H-pyrazol-3-yl)piperidine
Description:
4-(1H-pyrazol-3-yl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a pyrazole moiety. The pyrazole group, a five-membered ring containing two adjacent nitrogen atoms, is attached to the piperidine at the 4-position. This structural arrangement contributes to its potential biological activity and makes it of interest in medicinal chemistry. The compound may exhibit properties such as being a potential ligand for various biological targets, influencing its pharmacological profile. Its molecular structure suggests it could participate in hydrogen bonding and other interactions due to the presence of nitrogen atoms, which may enhance its solubility and reactivity. Additionally, the compound's unique combination of functional groups may lead to diverse applications in drug development, particularly in the fields of neuropharmacology and anti-inflammatory research. As with many heterocyclic compounds, its synthesis and characterization are crucial for understanding its reactivity and potential uses in various chemical and pharmaceutical applications.
Formula:C8H13N3
InChI:InChI=1/C8H13N3/c1-4-9-5-2-7(1)8-3-6-10-11-8/h3,6-7,9H,1-2,4-5H2,(H,10,11)
SMILES:C1CNCCC1c1cc[nH]n1
Synonyms:- piperidine, 4-(1H-pyrazol-3-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-(1H-pyrazol-3-yl)piperidine dihydrochloride hydrate
CAS:Formula:C8H17Cl2N3OPurity:98%Color and Shape:SolidMolecular weight:242.144-(1H-Pyrazol-3-yl)piperidine
CAS:4-(1H-Pyrazol-3-yl)piperidine is an antiviral agent that inhibits the CCR5 receptor. It has been shown to be active against asexual and sexual stages of malaria, with potency similar to chloroquine. 4-(1H-Pyrazol-3-yl)piperidine is metabolized by esterases in mammalian cells and has a short half-life, which makes it suitable for oral administration. The piperidine ring can be modified to create analogues with antiviral activity against HIV, influenza virus, herpes simplex virus type 1, or hepatitis B virus.
Formula:C8H13N3Purity:Min. 95%Molecular weight:151.21 g/mol


