CymitQuimica logo

CAS 2789-25-5

:

4-AMINO-2-CHLORO-3-NITROPYRIDINE

Description:
4-Amino-2-chloro-3-nitropyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features three functional groups: an amino group (-NH2), a chloro group (-Cl), and a nitro group (-NO2) attached to the pyridine ring. The presence of these substituents influences its chemical reactivity and properties, making it a potential candidate for various applications in pharmaceuticals and agrochemicals. Typically, it appears as a solid at room temperature and is soluble in polar solvents. The compound is known for its role in synthetic organic chemistry, particularly in the development of biologically active molecules. Its reactivity can be attributed to the electron-withdrawing effects of the nitro and chloro groups, which can enhance nucleophilicity at the amino position. Safety precautions should be taken when handling this compound, as it may pose health risks, including toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.
Formula:C5H4ClN3O2
InChI:InChI=1S/C5H4ClN3O2/c6-5-4(9(10)11)3(7)1-2-8-5/h1-2H,(H2,7,8)
InChI key:PDQAWJXOYURKPI-UHFFFAOYSA-N
SMILES:C1=CN=C(C(=C1N)[N+](=O)[O-])Cl
Synonyms:
  • 2-Chloro-3-Nitropyridin-4-Amine
Found 5 products.