CAS 2789-92-6
:3,5-Dichloroanthranilic acid
Description:
3,5-Dichloroanthranilic acid is an aromatic compound characterized by the presence of two chlorine atoms and an amino group attached to an anthranilic acid structure. It features a benzene ring fused to a carboxylic acid and an amino group, which contributes to its acidic properties. The chlorine substituents are located at the 3 and 5 positions of the aromatic ring, influencing the compound's reactivity and solubility. This compound is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. 3,5-Dichloroanthranilic acid is used in various applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Its chemical properties allow it to participate in electrophilic substitution reactions, making it a versatile building block in organic synthesis. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry and research. Proper handling and safety measures should be observed due to its potential toxicity and environmental impact.
Formula:C7H5Cl2NO2
InChI:InChI=1S/C7H5Cl2NO2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,10H2,(H,11,12)
InChI key:InChIKey=KTHTXLUIEAIGCD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C(Cl)=CC(Cl)=C1
Synonyms:- 2-Amino-3,5-Dichlorobenzoate
- 3,5-Dichloro-2-aminobenzoic acid
- 3,5-Dichloroanthranilic acid
- Ai3-17890
- Anthranilic acid, 3,5-dichloro-
- Benzoic acid, 2-amino-3,5-dichloro-
- Benzoic acid, 2-amino-3,5-dichloro- (9CI)
- Brn 0779100
- Nsc 1116
- 3-14-00-00966 (Beilstein Handbook Reference)
- 2-Amino-3,5-dichlorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
2-Amino-3,5-dichlorobenzoic Acid
CAS:Formula:C7H5Cl2NO2Purity:>97.0%(T)(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:206.022-Amino-3,5-dichlorobenzoic acid
CAS:Formula:C7H5Cl2NO2Purity:96%Color and Shape:SolidMolecular weight:206.02613,5-Dichloroanthranilic acid
CAS:Formula:C7H5Cl2NO2Purity:≥ 98.0%Color and Shape:Off-white to grey or brown powderMolecular weight:206.032-Amino-3,5-dichlorobenzoic acid
CAS:2-Amino-3,5-dichlorobenzoic acidPurity:98%Molecular weight:206.03g/mol3,5-Dichloroanthranilic acid
CAS:Formula:C7H5Cl2NO2Purity:96%Color and Shape:SolidMolecular weight:206.022-Amino-3,5-Dichlorobenzoic Acid
CAS:Controlled ProductFormula:C7H5Cl2NO2Color and Shape:NeatMolecular weight:204.972-Amino-3,5-dichlorobenzoic acid
CAS:2-Amino-3,5-dichlorobenzoic acid is a petrochemical that has been used in the production of other chemicals, such as phosphorus pentachloride. It also serves as a precursor for molybdenum and ATP binding cassette transporter. 2-Amino-3,5-dichlorobenzoic acid binds to the hydrochloric acid and sodium hydroxide solution present in the stomach to produce hydrochloric acid and sodium chloride. 2-Amino-3,5-dichlorobenzoic acid is also a precursor for quinazolone, which is used in the production of dyes and pharmaceuticals. It has also been shown to inhibit plant physiology by inhibiting chlorophyll synthesis.Formula:C7H5Cl2NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:206.03 g/mol









