CAS 27899-45-2

3,3-Dimethylbicyclo[2.2.1]heptane-2-methanol

Description:

3,3-Dimethylbicyclo[2.2.1]heptane-2-methanol, with the CAS number 27899-45-2, is a bicyclic organic compound characterized by its unique bicyclo[2.2.1]heptane structure, which consists of a seven-membered ring with two bridged carbon atoms. The presence of two methyl groups at the 3-position and a hydroxymethyl group at the 2-position contributes to its chemical properties. This compound is typically colorless and may exhibit a distinct odor, depending on its purity and concentration. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The compound may participate in various chemical reactions, including alcohol-related reactions, due to the hydroxyl group, making it a potential candidate for further chemical synthesis or as an intermediate in organic reactions. Its structural features may also influence its physical properties, such as boiling point and melting point, which are generally higher than those of simpler hydrocarbons. Overall, 3,3-Dimethylbicyclo[2.2.1]heptane-2-methanol is of interest in organic chemistry for its unique structure and potential applications.

Formula: C₁₀H₁₈O

InChI: InChI=1/C10H18O/c1-10(2)8-4-3-7(5-8)9(10)6-11/h7-9,11H,3-6H2,1-2H3

InChI key: InChIKey=GICBKEFIACFATK-UHFFFAOYSA-N

SMILES: C(O)C1C(C)(C)C2CC1CC2

Synonyms:

• Bicyclo[2.2.1]heptane-2-methanol, 3,3-dimethyl-
• 3,3-Dimethylbicyclo[2.2.1]heptane-2-methanol
• 2-Norbornanemethanol, 3,3-dimethyl-
• 3,3-Dimethylbicyclo(2.2.1)heptane-2-methanol
• Camphanol
• [3,3-Dimethylbicyclo[2.2.1]heptan-2-yl]methanol

(3,3-Dimethylbicyclo[2.2.1]heptan-2-yl)methanol

CAS: 27899-45-2

Versatile small molecule scaffold

Formula: C₁₀H₁₈O

Purity: Min. 95%

Molecular weight: 154.25 g/mol

Ref: 3D-CBA89945