CAS 279-24-3
:2-Azabicyclo[2.2.1]heptane
Description:
2-Azabicyclo[2.2.1]heptane, also known as norbornane-2-amine, is a bicyclic organic compound characterized by its unique structure, which features a nitrogen atom incorporated into a bicyclic framework. This compound has a molecular formula of C7H13N and is classified as a bicyclic amine. It exhibits a rigid, non-planar conformation due to the constraints of its bicyclic structure, which influences its reactivity and interaction with other molecules. 2-Azabicyclo[2.2.1]heptane is typically a colorless to pale yellow liquid with a distinctive amine odor. It is soluble in organic solvents and has limited solubility in water. The nitrogen atom in its structure can participate in hydrogen bonding, which affects its physical properties and potential applications. This compound is of interest in medicinal chemistry and organic synthesis, often serving as a building block for more complex molecules or as a ligand in coordination chemistry. Its unique structural features make it a valuable subject of study in various chemical research fields.
Formula:C6H11N
InChI:InChI=1/C6H11N/c1-2-6-3-5(1)4-7-6/h5-7H,1-4H2/t5-,6+/m0/s1
Synonyms:- (1R,4S)-2-azabicyclo[2.2.1]heptane
- 2-Azabicyclo(2.2.1)heptane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Azabicyclo[2.2.1]heptane
CAS:2-Azabicyclo[2.2.1]heptaneFormula:C6H11NPurity:97%Color and Shape: yellow solidMolecular weight:97.16g/mol2-Azabicyclo[2.2.1]heptane
CAS:Controlled ProductFormula:C6H11NColor and Shape:NeatMolecular weight:97.162-Azabicyclo[2.2.1]heptane
CAS:2-Azabicyclo[2.2.1]heptane is a lactam that has been synthesized in the laboratory. The compound exhibits significant antiproliferative activity and is shown to have a stereoselective, stereogenic, nucleophilic attack on amides. 2-Azabicyclo[2.2.1]heptane has been used to study the mechanisms of neurodegenerative diseases such as Parkinson's disease and Alzheimer's disease. The conformational properties of this compound can be determined by NMR spectra, which show that it has a skeleton with significant conformational flexibility.Formula:C6H11NPurity:Min. 95%Color and Shape:Red PowderMolecular weight:97.16 g/mol2-Azabicyclo[2.2.1]heptane
CAS:Formula:C6H11NPurity:95.0%Color and Shape:LiquidMolecular weight:97.161




