CymitQuimica logo

CAS 279-40-3

:

7-azabicyclo[2.2.1]heptane

Description:
7-Azabicyclo[2.2.1]heptane, also known as norbornane or bicyclo[2.2.1]heptan-7-amine, is a bicyclic organic compound characterized by its unique structure, which features a seven-membered ring containing a nitrogen atom. This compound is a derivative of bicyclo[2.2.1]heptane, where one of the carbon atoms is replaced by a nitrogen atom, resulting in a bicyclic amine. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the nitrogen atom contributes to its basicity and potential for forming hydrogen bonds, influencing its reactivity and interactions with other molecules. 7-Azabicyclo[2.2.1]heptane is of interest in various fields, including medicinal chemistry, due to its structural similarity to certain neurotransmitters and its potential applications in drug design. Its CAS number, 279-40-3, is used for identification in chemical databases and regulatory contexts. Overall, this compound exhibits interesting chemical properties that make it a subject of study in organic and medicinal chemistry.
Formula:C6H11N
InChI:InChI=1/C6H11N/c1-2-6-4-3-5(1)7-6/h5-7H,1-4H2
InChI key:SNZSSCZJMVIOCR-UHFFFAOYSA-N
SMILES:C1CC2CCC1N2
Synonyms:
  • 7-Azanorbornane
  • 7-azabicyclo(2.2.1)heptane
Found 3 products.