CymitQuimica logo

CAS 279-82-3

:

3-Azabicyclo[3.2.1]octane

Description:
3-Azabicyclo[3.2.1]octane, with the CAS number 279-82-3, is a bicyclic organic compound characterized by its unique structure that includes a nitrogen atom within a bicyclic framework. This compound features a seven-membered ring system that incorporates a saturated nitrogen atom, contributing to its basicity and potential reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the nitrogen atom allows for hydrogen bonding, which can influence its solubility in polar solvents. 3-Azabicyclo[3.2.1]octane is of interest in medicinal chemistry due to its structural similarity to various alkaloids and its potential applications in drug development. Its derivatives may exhibit biological activity, making it a subject of research in pharmacology. Additionally, the compound's unique bicyclic structure can lead to interesting stereochemical properties, which may affect its interactions with biological targets. Overall, 3-Azabicyclo[3.2.1]octane is a compound of significant interest in both synthetic and medicinal chemistry.
Formula:C7H13N
InChI:InChI=1S/C7H13N/c1-2-7-3-6(1)4-8-5-7/h6-8H,1-5H2
InChI key:CJQNJRRDTPULTL-UHFFFAOYSA-N
SMILES:C1CC2CC1CNC2
Synonyms:
  • 3-azabicyclo[3,2,1]octane Hydrochloride
Found 4 products.