CAS 2791-05-1
:adrenocorticotropic hormone fragment*1-10 human
Description:
Adrenocorticotropic hormone fragment 1-10 (ACTH 1-10) is a peptide derived from the larger adrenocorticotropic hormone, which plays a crucial role in the regulation of cortisol production from the adrenal glands. This specific fragment consists of the first ten amino acids of the ACTH molecule, retaining some biological activity associated with the regulation of adrenal function. The CAS number 2791-05-1 identifies this particular peptide in chemical databases. Characteristically, ACTH 1-10 is a small peptide, typically exhibiting properties such as solubility in water and stability under physiological conditions. It is often used in research to study the mechanisms of adrenal stimulation and the physiological effects of glucocorticoids. Additionally, due to its relatively small size, it can be synthesized using solid-phase peptide synthesis techniques, making it accessible for various experimental applications. Its biological activity, while diminished compared to the full-length ACTH, still provides insights into peptide hormone function and receptor interactions in endocrine signaling pathways.
Formula:C59H78N16O16S
InChI:InChI=1/C59H78N16O16S/c1-92-21-19-42(70-58(91)47(30-77)75-56(89)43(71-50(83)38(60)29-76)23-33-13-15-36(78)16-14-33)54(87)69-41(17-18-48(79)80)53(86)74-46(25-35-27-63-31-67-35)57(90)72-44(22-32-8-3-2-4-9-32)55(88)68-40(12-7-20-64-59(61)62)52(85)73-45(51(84)66-28-49(81)82)24-34-26-65-39-11-6-5-10-37(34)39/h2-6,8-11,13-16,26-27,31,38,40-47,65,76-78H,7,12,17-25,28-30,60H2,1H3,(H,63,67)(H,66,84)(H,68,88)(H,69,87)(H,70,91)(H,71,83)(H,72,90)(H,73,85)(H,74,86)(H,75,89)(H,79,80)(H,81,82)(H4,61,62,64)/t38-,40-,41-,42-,43-,44-,45-,46-,47-/m0/s1
SMILES:CSCC[C@@H](C(=N[C@@H](CCC(=O)O)C(=N[C@@H](Cc1cnc[nH]1)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1c[nH]c2ccccc12)C(=NCC(=O)O)O)O)O)O)O)O)N=C([C@H](CO)N=C([C@H](Cc1ccc(cc1)O)N=C([C@H](CO)N)O)O)O
Synonyms:- Acth (1-10)
- H-Ser-Tyr-Ser-Met-Glu-His-Phe-Arg-Trp-Gly-OH
- L-seryl-L-tyrosyl-L-seryl-L-methionyl-L-α-glutamyl-L-histidyl-L-phenylalanyl-L-arginyl-L-tryptophylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
ACTH (1-10)
CAS:ACTH (1–10) is a fragment of the ACTH hormone, which stimulates the adrenal cortex and the secretion of glucocorticoids such as cortisol. ACTH (1–10) appeared to delay the rate of extinction of the conditioned avoidance response in thyroidectomized rats.Formula:C59H78N16O16SPurity:96.9%Color and Shape:Whitish PowderMolecular weight:1299.43Adrenocorticotropic Hormone (ACTH) (1-10), human
CAS:ACTH (1-10), human: a weak α-MSH mimic at high doses (100-1000 nM), derived from adrenocorticotropin.Formula:C59H78N16O16SPurity:98%Color and Shape:SolidMolecular weight:1299.41

