CAS 2791-99-3
:3-hydroxyandrost-4-en-17-one
Description:
3-Hydroxyandrost-4-en-17-one, commonly known as androstenedione, is a steroid hormone that plays a crucial role in the biosynthesis of androgens and estrogens. It is characterized by its structure, which includes a steroid backbone with a hydroxyl group at the C3 position and a double bond between C4 and C5. This compound is a key intermediate in the steroidogenesis pathway, primarily produced in the adrenal glands and gonads. Androstenedione is involved in various physiological processes, including the regulation of sexual development and reproductive functions. It is also known for its potential use in sports and bodybuilding, although its use as a performance-enhancing substance is banned in many competitive sports due to its anabolic effects. In terms of solubility, it is relatively lipophilic, which influences its absorption and distribution in biological systems. The compound's CAS number, 2791-99-3, is a unique identifier that facilitates its identification in chemical databases and regulatory frameworks.
Formula:C19H28O2
InChI:InChI=1/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,13-16,20H,3-10H2,1-2H3/t13?,14-,15-,16-,18-,19-/m0/s1
SMILES:C[C@]12CCC(C=C1CC[C@H]1[C@@H]3CCC(=O)[C@@]3(C)CC[C@H]21)O
Synonyms:- Androst-4-En-17-One, 3-Hydroxy-
- 3-Hydroxyandrost-4-en-17-one
- (3R,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one
- 3α-Hydroxy-4-androstenone
- 4-ANDROSTEN-3α-OL-17-ONE
- Androst-4-en-17-one, 3-hydroxy-, (3α)-
- 3-hydroxy-4-androsten-17-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3α-Hydroxy-4-androstenone (1 mg/ml in Acetonitrile)
CAS:Controlled ProductFormula:C19H28O2Color and Shape:ColourlessMolecular weight:288.42

