CAS 27913-58-2

4-(P-iodophenyl)butyric acid

Description:

4-(P-Iodophenyl)butyric acid, with the CAS number 27913-58-2, is an organic compound characterized by its structure, which includes a butyric acid moiety attached to a para-iodophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in organic solvents and potential reactivity due to the presence of the iodine atom, which can participate in various chemical reactions. The iodine substituent can influence the compound's electronic properties, making it useful in medicinal chemistry and as a potential intermediate in organic synthesis. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. The compound may also exhibit biological activity, which can be explored in pharmacological studies. Overall, 4-(P-iodophenyl)butyric acid is notable for its unique structural features and potential applications in research and industry.

Formula: C₁₀H₁₁IO₂

InChI: InChI=1/C10H11IO2/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7H,1-3H2,(H,12,13)

SMILES: C(Cc1ccc(cc1)I)CC(=O)O

Synonyms:

• 4-(4-Iodophenyl)Butanoic Acid

4-(P-IODOPHENYL)BUTYRIC ACID

CAS: 27913-58-2

Formula: C₁₀H₁₁IO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 290.0976

Ref: IN-DA003KA2

4-(4-Iodophenyl)butanoic acid

CAS: 27913-58-2

4-(4-Iodophenyl)butanoic acid

Purity: 98%

Molecular weight: 290.10g/mol

Ref: 54-OR74755

4-(p-Iodophenyl)butyric Acid

CAS: 27913-58-2

Applications 4-(p-Iodophenyl)butyric Acid is a reactant involved in the synthesis of meta- and paracyclophanes containing unsaturated amino acids and intramolecular Friedel-Crafts reactions for synthesis of 1-tetralones.
References Gibson, S., et al.: Tetrahedron, 60, 6945 (2004); Cui, D., et al.: Tetrahedron Lett., 44, 4007 (2003)

Formula: C₁₀H₁₁IO₂

Color and Shape: Neat

Molecular weight: 290.10

Ref: TR-I717540

4-(p-Iodophenyl)butyric acid

CAS: 27913-58-2

4-(p-iodophenyl)butyric acid (4-IBBA) is a radiolabeled, non-toxic compound that is used in biotherapeutics to detect and treat cancer. 4-IBBA can be labeled with a small amount of radioactive iodine, which is then taken up by the tumor cells. The radioactivity can then be detected using a nuclear medicine imaging technique such as positron emission tomography (PET) or single photon emission computed tomography (SPECT). This compound also binds to human albumin and has been shown to bind to herpes simplex virus type 1 glycoprotein B.
4-IBBA has been shown to have pharmacokinetic properties that are similar to those of butyric acid, with rapid uptake into the gut and rapid excretion from the body. There are no long-term toxicities associated with this drug.

Formula: C₁₀H₁₁IO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 290.1 g/mol

Ref: 3D-FI46307

4-(p-Iodophenyl)butyric acid

CAS: 27913-58-2

Formula: C₁₀H₁₁IO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 290.1

Ref: 10-F307135