CAS 27913-98-0
:4-(1-Piperazinyl)benzaldehyde
Description:
4-(1-Piperazinyl)benzaldehyde, with the CAS number 27913-98-0, is an organic compound characterized by the presence of a piperazine ring attached to a benzaldehyde moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). Its molecular structure features a benzene ring substituted with an aldehyde group and a piperazine group, which contributes to its potential biological activity. The piperazine moiety is known for its role in various pharmacological applications, including as a scaffold in drug design. 4-(1-Piperazinyl)benzaldehyde may exhibit properties such as antimicrobial, anti-inflammatory, or psychoactive effects, making it of interest in medicinal chemistry. Additionally, it can serve as an intermediate in the synthesis of more complex organic compounds. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H14N2O
InChI:InChI=1S/C11H14N2O/c14-9-10-1-3-11(4-2-10)13-7-5-12-6-8-13/h1-4,9,12H,5-8H2
InChI key:InChIKey=BTTAIIUFVILNAC-UHFFFAOYSA-N
SMILES:C(=O)C1=CC=C(C=C1)N2CCNCC2
Synonyms:- 4-(1-Piperazinyl)benzaldehyde
- 4-Piperazin-1-yl-benzaldehyde
- Benzaldehyde, 4-(1-piperazinyl)-
- Benzaldehyde, p-1-piperazinyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Piperazin-1-ylbenzaldehyde
CAS:<p>4-Piperazin-1-ylbenzaldehyde</p>Formula:C11H14N2OPurity:≥95%Color and Shape: yellow solidMolecular weight:190.24g/mol4-Piperazin-1-yl-benzaldehyde
CAS:Formula:C11H14N2OPurity:97%(HPLC);RGColor and Shape:SolidMolecular weight:190.2464-Piperazin-1-yl-benzaldehyde
CAS:<p>4-Piperazin-1-yl-benzaldehyde (PPBA) is a natural product that has been shown to have effects on animals and cells. PPBA can be used as an antidote for sulfite poisoning, which is caused by the ingestion of sulfites in food or drink. The mechanism of PPBA's effects is not fully known, but it may involve the inhibition of sulfite reductase, which converts sulfites into sulfates. It also reversibly forms a complex with the transition state of the reaction, enhancing the rate of this reaction. This enhancement is due to a low detection limit and shift in solution temperature. PPBA has been shown to have fluorescence and fluorescent properties when exposed to light, making it useful for endogenous labeling.</p>Formula:C11H14N2OPurity:Min. 95%Molecular weight:190.24 g/mol


