CAS 27917-13-1
:5-Chloro-2-methylbenzylamine
Description:
5-Chloro-2-methylbenzylamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom and a methyl group, along with an amine functional group. The presence of the chlorine atom at the 5-position and the methyl group at the 2-position on the benzene ring contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The amine group makes it a basic compound, capable of forming salts with acids. Additionally, 5-Chloro-2-methylbenzylamine may exhibit moderate to high solubility in polar solvents, while its aromatic nature allows for interactions with various organic compounds. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C8H10ClN
InChI:InChI=1/C8H10ClN/c1-6-2-3-8(9)4-7(6)5-10/h2-4H,5,10H2,1H3
SMILES:Cc1ccc(cc1CN)Cl
Synonyms:- 1-(5-Chloro-2-Methylphenyl)Methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-CHLORO-2-METHYLBENZYLAMINE
CAS:Formula:C8H10ClNPurity:%Color and Shape:LiquidMolecular weight:155.62475-Chloro-2-methylbenzylamine
CAS:Formula:C8H10ClNPurity:95+%Color and Shape:LiquidMolecular weight:155.635-Chloro-2-methylbenzylamine
CAS:5-Chloro-2-methylbenzylamine is a chemical compound that has been shown to be an effective ozone depleter. It has also been used to study the relationship between chemical structure and reactivity, as well as in regression analysis. The ionic, nucleophilic, and electron properties of 5-Chloro-2-methylbenzylamine have been studied by looking at its affinity for different metal ions. This molecule can be used in organic pollutant remediation because of its ability to catalyze the regeneration of ozonide when it is oxidized by oxygen in water. This reaction is reversible, so 5-Chloro-2-methylbenzylamine can be regenerated from the ozonide product.
Formula:C8H10ClNPurity:Min. 95%Molecular weight:155.63 g/mol




