CAS 27918-19-0
:Benzenesulfonamide, 4-hydrazinyl-, hydrochloride (1:?)
Description:
Benzenesulfonamide, 4-hydrazinyl-, hydrochloride (CAS 27918-19-0) is a chemical compound characterized by its sulfonamide functional group and a hydrazine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. It is often used in pharmaceutical research and development, particularly in the synthesis of various bioactive molecules. The hydrazinyl group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, compounds of this nature may exhibit biological activity, including potential antimicrobial or antitumor properties, although specific biological effects would depend on the context of use and further study. Safety data should be consulted, as sulfonamides can cause allergic reactions in some individuals. Proper handling and storage conditions are essential to ensure stability and safety when working with this compound.
Formula:C6H9N3O2S·xClH
InChI:InChI=1S/C6H9N3O2S.ClH/c7-9-5-1-3-6(4-2-5)12(8,10)11;/h1-4,9H,7H2,(H2,8,10,11);1H
InChI key:InChIKey=IKEURONJLPUALY-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC=C(NN)C=C1.Cl
Synonyms:- (4-Sulfamylphenyl)hydrazine hydrochloride
- 4-Hydrazino Benzene Sulfonamide Hydrochloride
- 4-Hydrazinobenzene-1-sulfonamide hydrochloride
- 4-Hydrazinobenzenesulfonamide Hydrochloride
- 4-SAPH.HCl
- 4-Sulfonamide-phenylhydrazine hydrochloride
- 4-Sulfonamidophenylhydrazine HCl
- 4-Sulphonamidophenylhydrazine Hydrochloride
- Benzenesulfonamide, 4-hydrazino-, hydrochloride
- Benzenesulfonamide, 4-hydrazinyl-, hydrochloride (1:?)
- Benzenesulfonamide, p-hydrazino-, hydrochloride
- Phenylhydrazine-4-sulfonamide hydrochloride
- Sulfonamide-phenylhydrazine hydrochloride, 4-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzenesulfonamide, 4-hydrazino-, hydrochloride
CAS:Formula:C6H10ClN3O2SPurity:95%Color and Shape:SolidMolecular weight:223.68054-Hydrazinylbenzenesulfonamide Hydrochloride
CAS:4-Hydrazinylbenzenesulfonamide HydrochloridePurity:96%Molecular weight:223.68g/mol4-Sulfonamide phenylhydrazine hydrochloride
CAS:Formula:C6H10ClN3O2SPurity:≥ 99.0%Color and Shape:White to light-yellow powderMolecular weight:223.684-Sulfonamidephenylhydrazine hydrochloride
CAS:4-Sulfonamidephenylhydrazine HCl is a sulfonamide that inhibits the enzyme Cox-2, which is involved in inflammation. It also has anti-inflammatory activity and has been shown to inhibit the growth of fungi. 4-Sulfonamidephenylhydrazine HCl is an antifungal agent used for the treatment of dermatophytic infections such as tinea pedis and tinea cruris. The chemical structure of 4-Sulfonamidephenylhydrazine HCl consists of a methyl sulfone group linked with a pyrazole ring and a hydrazine hydrate group. The carbonic acid moiety in this compound stabilizes the pyrazole ring by forming hydrogen bonds with the nitrogen atom and oxygen atom on either side of it. This allows for the formation of two resonance structures to be maintained, which make it more stable than other similar compounds without this moiety.Formula:C6H9N3O2S•(HCl)xPurity:Min. 95%Color and Shape:PowderMolecular weight:223.68 g/mol





