CAS 279215-43-9

6-Chloro-3-(1-methylcyclopropylamino)-4H-thieno[3,2-e][1,2,4]thiadiazine-1,1-dioxide

Description:

6-Chloro-3-(1-methylcyclopropylamino)-4H-thieno[3,2-e][1,2,4]thiadiazine-1,1-dioxide is a chemical compound characterized by its complex heterocyclic structure, which includes a thieno-thiadiazine core. This compound features a chlorine atom at the 6-position and a 1-methylcyclopropylamino group at the 3-position, contributing to its unique reactivity and potential biological activity. The presence of the 1,1-dioxide functional group indicates that it has two oxygen atoms double-bonded to the sulfur atom in the thiadiazine ring, which can influence its chemical properties, such as solubility and stability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific interactions and mechanisms of action would depend on its molecular structure and the functional groups present. As with many heterocyclic compounds, it may also display interesting electronic properties due to the conjugated system within its ring structure.

Formula: C₉H₁₀ClN₃O₂S₂

InChI: InChI=1/C9H10ClN3O2S2/c1-9(2-3-9)12-8-11-5-4-6(10)16-7(5)17(14,15)13-8/h4H,2-3H2,1H3,(H2,11,12,13)

SMILES: CC1(CC1)NC1=Nc2cc(Cl)sc2S(=O)(=O)N1

Synonyms:

• Tifenazoxide
• Nn-414
• 6-chloro-N-(1-methylcyclopropyl)-4H-thieno[3,2-e][1,2,4]thiadiazin-3-amine 1,1-dioxide

Tifenazoxide

CAS: 279215-43-9

Tifenazoxide is an effective and SUR1/Kir6.2 selective KATP channels opener. Tifenazoxide has an anti-diabetic effect, can inhibit glucose-stimulated insulin release in vitro and in vivo.

Formula: C₉H₁₀ClN₃O₂S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 291.78

Ref: TM-T17094