CAS 279227-02-0
:1-(2-hydroxyethyl)-2-methyl-1H-benzimidazole-5-carboxylate
Description:
1-(2-Hydroxyethyl)-2-methyl-1H-benzimidazole-5-carboxylate, with the CAS number 279227-02-0, is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a hydroxyl group and an ethyl group attached to the nitrogen of the imidazole, contributing to its solubility and reactivity. The carboxylate group at the 5-position enhances its potential for forming salts and participating in various chemical reactions. It is typically used in pharmaceutical applications, particularly in the development of drugs due to its biological activity. The presence of the hydroxyl and carboxylate groups suggests that it may exhibit hydrogen bonding capabilities, influencing its interactions with biological targets. Additionally, the methyl group at the 2-position can affect the compound's lipophilicity and overall pharmacokinetic properties. Overall, this compound's unique structure and functional groups make it a subject of interest in medicinal chemistry and related fields.
Formula:C11H11N2O3
InChI:InChI=1/C11H12N2O3/c1-7-12-9-6-8(11(15)16)2-3-10(9)13(7)4-5-14/h2-3,6,14H,4-5H2,1H3,(H,15,16)/p-1
SMILES:Cc1nc2cc(ccc2n1CCO)C(=O)[O-]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-(2-Hydroxyethyl)-2-methyl-1H-1,3-benzodiazole-5-carboxylic acid
CAS:<p>1-(2-Hydroxyethyl)-2-methyl-1H-1,3-benzodiazole-5-carboxylic acid is an antiinflammatory drug that belongs to the class of methyl esters. It has been shown to have a spectrum of activity against cancer cells in vitro and in vivo, including human leukemia and lymphoma cells. 1-(2-Hydroxyethyl)-2-methyl-1H-1,3-benzodiazole-5-carboxylic acid has also been shown to inhibit the growth of methicillin resistant Staphylococcus aureus (MRSA) and Clostridium perfringens. The chemical composition of 1-(2-Hydroxyethyl)-2-methyl-1H-1,3 benzodiazole 5 carboxylic acid is not yet known.</p>Formula:C11H12N2O3Purity:Min. 95%Molecular weight:220.22 g/mol
