CAS 279236-32-7

3-(1H-imidazol-1-yl)-N-(pyridin-4-ylmethyl)propan-1-amine

Description:

3-(1H-imidazol-1-yl)-N-(pyridin-4-ylmethyl)propan-1-amine, with the CAS number 279236-32-7, is a chemical compound characterized by its complex structure, which includes an imidazole ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic amines and aromatic systems, contributing to its potential biological activity. It is likely to be soluble in polar solvents due to the presence of amine functional groups, which can engage in hydrogen bonding. The imidazole and pyridine rings may impart specific electronic properties, influencing its reactivity and interaction with biological targets. Such compounds are often investigated for their pharmacological potential, including roles as enzyme inhibitors or receptor modulators. The presence of multiple functional groups suggests that it may participate in various chemical reactions, making it a candidate for further research in medicinal chemistry and drug development. Overall, its unique structural features position it as a compound of interest in both synthetic and biological chemistry contexts.

Formula: C₁₂H₁₆N₄

InChI: InChI=1/C12H16N4/c1(8-16-9-7-15-11-16)4-14-10-12-2-5-13-6-3-12/h2-3,5-7,9,11,14H,1,4,8,10H2

SMILES: C(CNCc1ccncc1)Cn1ccnc1

Synonyms:

• 4-pyridinemethanamine, N-[3-(1H-imidazol-1-yl)propyl]-

[3-(1H-imidazol-1-yl)propyl](4-pyridinylmethyl)amine dihydrochloride

CAS: 279236-32-7

Formula: C₁₂H₁₈Cl₂N₄

Purity: 95.0%

Molecular weight: 289.2

Ref: 10-F361821